C31H34F5N3O2+2 — CID 91081415
3-[6,6-diethyl-9,11-difluoro-2-heptyl-10-(trifluoromethyl)benzo[a]quinolizin-5-ium-7-ylidene]-6-methylimidazo[1,5-c][1,3]oxazol-6-ium-1-one (PubChem CID 91081415) has the molecular formula C31H34F5N3O2+2 and a molecular weight of 575.62 g/mol. Its IUPAC name is 3-[6,6-diethyl-9,11-difluoro-2-heptyl-10-(trifluoromethyl)benzo[a]quinolizin-5-ium-7-ylidene]-6-methylimidazo[1,5-c][1,3]oxazol-6-ium-1-one.
| Compound Name | 3-[6,6-diethyl-9,11-difluoro-2-heptyl-10-(trifluoromethyl)benzo[a]quinolizin-5-ium-7-ylidene]-6-methylimidazo[1,5-c][1,3]oxazol-6-ium-1-one |
|---|---|
| PubChem CID | 91081415 |
| Molecular Formula | C31H34F5N3O2+2 |
| Molecular Weight | 575.62 g/mol |
| Exact Mass | 575.26 |
| IUPAC Name | 3-[6,6-diethyl-9,11-difluoro-2-heptyl-10-(trifluoromethyl)benzo[a]quinolizin-5-ium-7-ylidene]-6-methylimidazo[1,5-c][1,3]oxazol-6-ium-1-one |
| SMILES | CCCCCCCc1cc[n+]2c(c1)-c1c(cc(F)c(C(F)(F)F)c1F)C(=c1oc(=O)c3c[n+](C)cn13)C2(CC)CC |
| InChI | InChI=1S/C31H34F5N3O2/c1-5-8-9-10-11-12-19-13-14-39-22(15-19)24-20(16-21(32)26(27(24)33)31(34,35)36)25(30(39,6-2)7-3)28-38-18-37(4)17-23(38)29(40)41-28/h13-18H,5-12H2,1-4H3/q+2 |
| InChIKey | KLXGNYCYYFGOFY-UHFFFAOYSA-N |
| XLogP | 5.93 |
| TPSA | 42.38 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 3 |
| Rotatable Bonds | 8 |
| Heavy Atoms | 41 |
| Complexity | — |
2 violations
| Rule | Value |
|---|---|
| MW ≤ 500 | 575.62 |
| LogP ≤ 5 | 5.93 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 3 |
| Structural Alerts | {'alert_name': 'Aliphatic_long_chain', 'substructure': 'N/A'}, {'alert_name': 'quaternary_nitrogen_1', 'substructure': 'N/A'} |
|---|