C28H26F2N4O2+2 — CID 91040477
6-ethyl-9,11-difluoro-6-methyl-7-(1-methyl-7-oxoimidazo[1,2-c][1,3]oxazol-1-ium-5-ylidene)-2-pent-4-enylbenzo[a]quinolizin-5-ium-10-carbonitrile (PubChem CID 91040477) has the molecular formula C28H26F2N4O2+2 and a molecular weight of 488.54 g/mol. Its IUPAC name is 6-ethyl-9,11-difluoro-6-methyl-7-(1-methyl-7-oxoimidazo[1,2-c][1,3]oxazol-1-ium-5-ylidene)-2-pent-4-enylbenzo[a]quinolizin-5-ium-10-carbonitrile.
| Compound Name | 6-ethyl-9,11-difluoro-6-methyl-7-(1-methyl-7-oxoimidazo[1,2-c][1,3]oxazol-1-ium-5-ylidene)-2-pent-4-enylbenzo[a]quinolizin-5-ium-10-carbonitrile |
|---|---|
| PubChem CID | 91040477 |
| Molecular Formula | C28H26F2N4O2+2 |
| Molecular Weight | 488.54 g/mol |
| Exact Mass | 488.20 |
| IUPAC Name | 6-ethyl-9,11-difluoro-6-methyl-7-(1-methyl-7-oxoimidazo[1,2-c][1,3]oxazol-1-ium-5-ylidene)-2-pent-4-enylbenzo[a]quinolizin-5-ium-10-carbonitrile |
| SMILES | C=CCCCc1cc[n+]2c(c1)-c1c(cc(F)c(C#N)c1F)C(=c1oc(=O)c3n1cc[n+]3C)C2(C)CC |
| InChI | InChI=1S/C28H26F2N4O2/c1-5-7-8-9-17-10-11-34-21(14-17)22-18(15-20(29)19(16-31)24(22)30)23(28(34,3)6-2)26-33-13-12-32(4)25(33)27(35)36-26/h5,10-15H,1,6-9H2,2-4H3/q+2 |
| InChIKey | AVWSQEBUYHPPHF-UHFFFAOYSA-N |
| XLogP | 3.39 |
| TPSA | 66.17 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 4 |
| Rotatable Bonds | 5 |
| Heavy Atoms | 36 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 488.54 |
| LogP ≤ 5 | 3.39 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 4 |
| Structural Alerts | {'alert_name': 'Aliphatic_long_chain', 'substructure': 'N/A'}, {'alert_name': 'isolated_alkene', 'substructure': 'N/A'}, {'alert_name': 'quaternary_nitrogen_1', 'substructure': 'N/A'} |
|---|