C30H32F2N4O2+2 — CID 91073244
6,6-diethyl-9,11-difluoro-2-heptyl-7-(7-oxoimidazo[1,2-c][1,3]oxazol-1-ium-5-ylidene)benzo[a]quinolizin-5-ium-10-carbonitrile (PubChem CID 91073244) has the molecular formula C30H32F2N4O2+2 and a molecular weight of 518.61 g/mol. Its IUPAC name is 6,6-diethyl-9,11-difluoro-2-heptyl-7-(7-oxoimidazo[1,2-c][1,3]oxazol-1-ium-5-ylidene)benzo[a]quinolizin-5-ium-10-carbonitrile.
| Compound Name | 6,6-diethyl-9,11-difluoro-2-heptyl-7-(7-oxoimidazo[1,2-c][1,3]oxazol-1-ium-5-ylidene)benzo[a]quinolizin-5-ium-10-carbonitrile |
|---|---|
| PubChem CID | 91073244 |
| Molecular Formula | C30H32F2N4O2+2 |
| Molecular Weight | 518.61 g/mol |
| Exact Mass | 518.25 |
| IUPAC Name | 6,6-diethyl-9,11-difluoro-2-heptyl-7-(7-oxoimidazo[1,2-c][1,3]oxazol-1-ium-5-ylidene)benzo[a]quinolizin-5-ium-10-carbonitrile |
| SMILES | CCCCCCCc1cc[n+]2c(c1)-c1c(cc(F)c(C#N)c1F)C(=c1oc(=O)c3[nH+]ccn13)C2(CC)CC |
| InChI | InChI=1S/C30H31F2N4O2/c1-4-7-8-9-10-11-19-12-14-36-23(16-19)24-20(17-22(31)21(18-33)26(24)32)25(30(36,5-2)6-3)28-35-15-13-34-27(35)29(37)38-28/h12-17H,4-11H2,1-3H3/q+1/p+1 |
| InChIKey | JNKSDKPQXFTVNR-UHFFFAOYSA-O |
| XLogP | 4.77 |
| TPSA | 76.43 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 4 |
| Rotatable Bonds | 8 |
| Heavy Atoms | 38 |
| Complexity | — |
1 violation
| Rule | Value |
|---|---|
| MW ≤ 500 | 518.61 |
| LogP ≤ 5 | 4.77 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 4 |
| Structural Alerts | {'alert_name': 'Aliphatic_long_chain', 'substructure': 'N/A'}, {'alert_name': 'quaternary_nitrogen_1', 'substructure': 'N/A'} |
|---|