C31H34F5N3O2+2 — CID 90951414
[2,4-diethyl-7,9-difluoro-13-hexyl-8-(trifluoromethyl)-1-azoniatetracyclo[9.4.0.02,4.05,10]pentadeca-1(11),5,7,9,12,14-hexaen-3-ylidene]methyl 3-methyl-1H-imidazol-3-ium-2-carboxylate (PubChem CID 90951414) has the molecular formula C31H34F5N3O2+2 and a molecular weight of 575.62 g/mol. Its IUPAC name is [2,4-diethyl-7,9-difluoro-13-hexyl-8-(trifluoromethyl)-1-azoniatetracyclo[9.4.0.02,4.05,10]pentadeca-1(11),5,7,9,12,14-hexaen-3-ylidene]methyl 3-methyl-1H-imidazol-3-ium-2-carboxylate.
| Compound Name | [2,4-diethyl-7,9-difluoro-13-hexyl-8-(trifluoromethyl)-1-azoniatetracyclo[9.4.0.02,4.05,10]pentadeca-1(11),5,7,9,12,14-hexaen-3-ylidene]methyl 3-methyl-1H-imidazol-3-ium-2-carboxylate |
|---|---|
| PubChem CID | 90951414 |
| Molecular Formula | C31H34F5N3O2+2 |
| Molecular Weight | 575.62 g/mol |
| Exact Mass | 575.26 |
| IUPAC Name | [2,4-diethyl-7,9-difluoro-13-hexyl-8-(trifluoromethyl)-1-azoniatetracyclo[9.4.0.02,4.05,10]pentadeca-1(11),5,7,9,12,14-hexaen-3-ylidene]methyl 3-methyl-1H-imidazol-3-ium-2-carboxylate |
| SMILES | CCCCCCc1cc[n+]2c(c1)-c1c(cc(F)c(C(F)(F)F)c1F)C1(CC)C(=COC(=O)c3[nH]cc[n+]3C)C21CC |
| InChI | InChI=1S/C31H33F5N3O2/c1-5-8-9-10-11-19-12-14-39-22(16-19)24-20(17-21(32)25(26(24)33)31(34,35)36)29(6-2)23(30(29,39)7-3)18-41-28(40)27-37-13-15-38(27)4/h12-18H,5-11H2,1-4H3/q+1/p+1 |
| InChIKey | CGXGJHXGCAGZNI-UHFFFAOYSA-O |
| XLogP | 6.73 |
| TPSA | 49.85 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 2 |
| Rotatable Bonds | 9 |
| Heavy Atoms | 41 |
| Complexity | — |
2 violations
| Rule | Value |
|---|---|
| MW ≤ 500 | 575.62 |
| LogP ≤ 5 | 6.73 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 2 |
| Structural Alerts | {'alert_name': 'acyclic_C=C-O', 'substructure': 'N/A'}, {'alert_name': 'Aliphatic_long_chain', 'substructure': 'N/A'}, {'alert_name': 'quaternary_nitrogen_1', 'substructure': 'N/A'} |
|---|