C22H15F2N3O2+2 — CID 90996650
5-[7,7-bis(ethenyl)-9,11-difluorobenzo[a]quinolizin-5-ium-6-ylidene]imidazo[1,2-c][1,3]oxazol-1-ium-7-one (PubChem CID 90996650) has the molecular formula C22H15F2N3O2+2 and a molecular weight of 391.38 g/mol. Its IUPAC name is 5-[7,7-bis(ethenyl)-9,11-difluorobenzo[a]quinolizin-5-ium-6-ylidene]imidazo[1,2-c][1,3]oxazol-1-ium-7-one.
| Compound Name | 5-[7,7-bis(ethenyl)-9,11-difluorobenzo[a]quinolizin-5-ium-6-ylidene]imidazo[1,2-c][1,3]oxazol-1-ium-7-one |
|---|---|
| PubChem CID | 90996650 |
| Molecular Formula | C22H15F2N3O2+2 |
| Molecular Weight | 391.38 g/mol |
| Exact Mass | 391.11 |
| IUPAC Name | 5-[7,7-bis(ethenyl)-9,11-difluorobenzo[a]quinolizin-5-ium-6-ylidene]imidazo[1,2-c][1,3]oxazol-1-ium-7-one |
| SMILES | C=CC1(C=C)C(=c2oc(=O)c3[nH+]ccn23)[n+]2ccccc2-c2c(F)cc(F)cc21 |
| InChI | InChI=1S/C22H14F2N3O2/c1-3-22(4-2)14-11-13(23)12-15(24)17(14)16-7-5-6-9-26(16)18(22)20-27-10-8-25-19(27)21(28)29-20/h3-12H,1-2H2/q+1/p+1 |
| InChIKey | MKZXAWDFWYBMSB-UHFFFAOYSA-O |
| XLogP | 1.94 |
| TPSA | 52.64 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 3 |
| Rotatable Bonds | 2 |
| Heavy Atoms | 29 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 391.38 |
| LogP ≤ 5 | 1.94 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 3 |
| Structural Alerts | {'alert_name': 'isolated_alkene', 'substructure': 'N/A'}, {'alert_name': 'quaternary_nitrogen_1', 'substructure': 'N/A'} |
|---|