C25H21F2N3O2+2 — CID 90966543
3-(7,9-difluoro-4,13-dimethyl-2-prop-1-en-2-yl-1-azoniatetracyclo[9.4.0.02,4.05,10]pentadeca-1(11),5(10),6,8,12,14-hexaen-3-ylidene)-7-methylimidazo[1,5-c][1,3]oxazol-6-ium-1-one (PubChem CID 90966543) has the molecular formula C25H21F2N3O2+2 and a molecular weight of 433.46 g/mol. Its IUPAC name is 3-(7,9-difluoro-4,13-dimethyl-2-prop-1-en-2-yl-1-azoniatetracyclo[9.4.0.02,4.05,10]pentadeca-1(11),5(10),6,8,12,14-hexaen-3-ylidene)-7-methylimidazo[1,5-c][1,3]oxazol-6-ium-1-one.
| Compound Name | 3-(7,9-difluoro-4,13-dimethyl-2-prop-1-en-2-yl-1-azoniatetracyclo[9.4.0.02,4.05,10]pentadeca-1(11),5(10),6,8,12,14-hexaen-3-ylidene)-7-methylimidazo[1,5-c][1,3]oxazol-6-ium-1-one |
|---|---|
| PubChem CID | 90966543 |
| Molecular Formula | C25H21F2N3O2+2 |
| Molecular Weight | 433.46 g/mol |
| Exact Mass | 433.16 |
| IUPAC Name | 3-(7,9-difluoro-4,13-dimethyl-2-prop-1-en-2-yl-1-azoniatetracyclo[9.4.0.02,4.05,10]pentadeca-1(11),5(10),6,8,12,14-hexaen-3-ylidene)-7-methylimidazo[1,5-c][1,3]oxazol-6-ium-1-one |
| SMILES | C=C(C)C12C(=c3oc(=O)c4c(C)[nH+]cn34)C1(C)c1cc(F)cc(F)c1-c1cc(C)cc[n+]12 |
| InChI | InChI=1S/C25H20F2N3O2/c1-12(2)25-21(22-29-11-28-14(4)20(29)23(31)32-22)24(25,5)16-9-15(26)10-17(27)19(16)18-8-13(3)6-7-30(18)25/h6-11H,1H2,2-5H3/q+1/p+1 |
| InChIKey | YBEHAVCUDLXSBK-UHFFFAOYSA-O |
| XLogP | 2.68 |
| TPSA | 52.64 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 3 |
| Rotatable Bonds | 1 |
| Heavy Atoms | 32 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 433.46 |
| LogP ≤ 5 | 2.68 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 3 |
| Structural Alerts | {'alert_name': 'isolated_alkene', 'substructure': 'N/A'}, {'alert_name': 'quaternary_nitrogen_1', 'substructure': 'N/A'} |
|---|