C26H22F5N3O2+2 — CID 91177986
5-[4-ethyl-7,9-difluoro-13-methyl-2-propyl-8-(trifluoromethyl)-1-azoniatetracyclo[9.4.0.02,4.05,10]pentadeca-1(11),5,7,9,12,14-hexaen-3-ylidene]imidazo[1,2-c][1,3]oxazol-1-ium-7-one (PubChem CID 91177986) has the molecular formula C26H22F5N3O2+2 and a molecular weight of 503.47 g/mol. Its IUPAC name is 5-[4-ethyl-7,9-difluoro-13-methyl-2-propyl-8-(trifluoromethyl)-1-azoniatetracyclo[9.4.0.02,4.05,10]pentadeca-1(11),5,7,9,12,14-hexaen-3-ylidene]imidazo[1,2-c][1,3]oxazol-1-ium-7-one.
| Compound Name | 5-[4-ethyl-7,9-difluoro-13-methyl-2-propyl-8-(trifluoromethyl)-1-azoniatetracyclo[9.4.0.02,4.05,10]pentadeca-1(11),5,7,9,12,14-hexaen-3-ylidene]imidazo[1,2-c][1,3]oxazol-1-ium-7-one |
|---|---|
| PubChem CID | 91177986 |
| Molecular Formula | C26H22F5N3O2+2 |
| Molecular Weight | 503.47 g/mol |
| Exact Mass | 503.16 |
| IUPAC Name | 5-[4-ethyl-7,9-difluoro-13-methyl-2-propyl-8-(trifluoromethyl)-1-azoniatetracyclo[9.4.0.02,4.05,10]pentadeca-1(11),5,7,9,12,14-hexaen-3-ylidene]imidazo[1,2-c][1,3]oxazol-1-ium-7-one |
| SMILES | CCCC12C(=c3oc(=O)c4[nH+]ccn34)C1(CC)c1cc(F)c(C(F)(F)F)c(F)c1-c1cc(C)cc[n+]12 |
| InChI | InChI=1S/C26H21F5N3O2/c1-4-7-25-20(22-33-10-8-32-21(33)23(35)36-22)24(25,5-2)14-12-15(27)18(26(29,30)31)19(28)17(14)16-11-13(3)6-9-34(16)25/h6,8-12H,4-5,7H2,1-3H3/q+1/p+1 |
| InChIKey | RZMAMYTUUKKCHZ-UHFFFAOYSA-O |
| XLogP | 4.01 |
| TPSA | 52.64 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 3 |
| Rotatable Bonds | 3 |
| Heavy Atoms | 36 |
| Complexity | — |
1 violation
| Rule | Value |
|---|---|
| MW ≤ 500 | 503.47 |
| LogP ≤ 5 | 4.01 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 3 |
| Structural Alerts | {'alert_name': 'quaternary_nitrogen_1', 'substructure': 'N/A'} |
|---|