C27H28F2N4O2+2 — CID 90885773
7-(1,2-dimethyl-8-oxo-5,6-dihydroimidazo[2,1-c][1,4]oxazin-4-ium-6-yl)-6,6-diethyl-9,11-difluoro-2-methyl-7H-benzo[a]quinolizin-5-ium-10-carbonitrile (PubChem CID 90885773) has the molecular formula C27H28F2N4O2+2 and a molecular weight of 478.54 g/mol. Its IUPAC name is 7-(1,2-dimethyl-8-oxo-5,6-dihydroimidazo[2,1-c][1,4]oxazin-4-ium-6-yl)-6,6-diethyl-9,11-difluoro-2-methyl-7H-benzo[a]quinolizin-5-ium-10-carbonitrile.
| Compound Name | 7-(1,2-dimethyl-8-oxo-5,6-dihydroimidazo[2,1-c][1,4]oxazin-4-ium-6-yl)-6,6-diethyl-9,11-difluoro-2-methyl-7H-benzo[a]quinolizin-5-ium-10-carbonitrile |
|---|---|
| PubChem CID | 90885773 |
| Molecular Formula | C27H28F2N4O2+2 |
| Molecular Weight | 478.54 g/mol |
| Exact Mass | 478.22 |
| IUPAC Name | 7-(1,2-dimethyl-8-oxo-5,6-dihydroimidazo[2,1-c][1,4]oxazin-4-ium-6-yl)-6,6-diethyl-9,11-difluoro-2-methyl-7H-benzo[a]quinolizin-5-ium-10-carbonitrile |
| SMILES | CCC1(CC)C(C2C[n+]3cc(C)n(C)c3C(=O)O2)c2cc(F)c(C#N)c(F)c2-c2cc(C)cc[n+]21 |
| InChI | InChI=1S/C27H28F2N4O2/c1-6-27(7-2)23(21-14-32-13-16(4)31(5)25(32)26(34)35-21)17-11-19(28)18(12-30)24(29)22(17)20-10-15(3)8-9-33(20)27/h8-11,13,21,23H,6-7,14H2,1-5H3/q+2 |
| InChIKey | UNFVCSPIEKEWTE-UHFFFAOYSA-N |
| XLogP | 3.89 |
| TPSA | 62.78 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 4 |
| Rotatable Bonds | 3 |
| Heavy Atoms | 35 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 478.54 |
| LogP ≤ 5 | 3.89 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 4 |
| Structural Alerts | {'alert_name': 'quaternary_nitrogen_1', 'substructure': 'N/A'} |
|---|