C27H31F2N3O3+2 — CID 90766535
6-(6,6-diethyl-9,11-difluoro-2-methoxy-7-methylbenzo[a]quinolizin-5-ium-7-yl)-1,2-dimethyl-5,6-dihydroimidazo[2,1-c][1,4]oxazin-4-ium-8-one (PubChem CID 90766535) has the molecular formula C27H31F2N3O3+2 and a molecular weight of 483.56 g/mol. Its IUPAC name is 6-(6,6-diethyl-9,11-difluoro-2-methoxy-7-methylbenzo[a]quinolizin-5-ium-7-yl)-1,2-dimethyl-5,6-dihydroimidazo[2,1-c][1,4]oxazin-4-ium-8-one.
| Compound Name | 6-(6,6-diethyl-9,11-difluoro-2-methoxy-7-methylbenzo[a]quinolizin-5-ium-7-yl)-1,2-dimethyl-5,6-dihydroimidazo[2,1-c][1,4]oxazin-4-ium-8-one |
|---|---|
| PubChem CID | 90766535 |
| Molecular Formula | C27H31F2N3O3+2 |
| Molecular Weight | 483.56 g/mol |
| Exact Mass | 483.23 |
| IUPAC Name | 6-(6,6-diethyl-9,11-difluoro-2-methoxy-7-methylbenzo[a]quinolizin-5-ium-7-yl)-1,2-dimethyl-5,6-dihydroimidazo[2,1-c][1,4]oxazin-4-ium-8-one |
| SMILES | CCC1(CC)[n+]2ccc(OC)cc2-c2c(F)cc(F)cc2C1(C)C1C[n+]2cc(C)n(C)c2C(=O)O1 |
| InChI | InChI=1S/C27H31F2N3O3/c1-7-27(8-2)26(4,22-15-31-14-16(3)30(5)24(31)25(33)35-22)19-11-17(28)12-20(29)23(19)21-13-18(34-6)9-10-32(21)27/h9-14,22H,7-8,15H2,1-6H3/q+2 |
| InChIKey | FEOJZQIFKFKDOO-UHFFFAOYSA-N |
| XLogP | 3.89 |
| TPSA | 48.22 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 4 |
| Rotatable Bonds | 4 |
| Heavy Atoms | 35 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 483.56 |
| LogP ≤ 5 | 3.89 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 4 |
| Structural Alerts | {'alert_name': 'quaternary_nitrogen_1', 'substructure': 'N/A'} |
|---|