C26H29F2N3O2+2 — CID 91114559
6-(7,7-diethyl-9,11-difluoro-2-methyl-6H-benzo[a]quinolizin-5-ium-6-yl)-1,2-dimethyl-5,6-dihydroimidazo[2,1-c][1,4]oxazin-4-ium-8-one (PubChem CID 91114559) has the molecular formula C26H29F2N3O2+2 and a molecular weight of 453.53 g/mol. Its IUPAC name is 6-(7,7-diethyl-9,11-difluoro-2-methyl-6H-benzo[a]quinolizin-5-ium-6-yl)-1,2-dimethyl-5,6-dihydroimidazo[2,1-c][1,4]oxazin-4-ium-8-one.
| Compound Name | 6-(7,7-diethyl-9,11-difluoro-2-methyl-6H-benzo[a]quinolizin-5-ium-6-yl)-1,2-dimethyl-5,6-dihydroimidazo[2,1-c][1,4]oxazin-4-ium-8-one |
|---|---|
| PubChem CID | 91114559 |
| Molecular Formula | C26H29F2N3O2+2 |
| Molecular Weight | 453.53 g/mol |
| Exact Mass | 453.22 |
| IUPAC Name | 6-(7,7-diethyl-9,11-difluoro-2-methyl-6H-benzo[a]quinolizin-5-ium-6-yl)-1,2-dimethyl-5,6-dihydroimidazo[2,1-c][1,4]oxazin-4-ium-8-one |
| SMILES | CCC1(CC)c2cc(F)cc(F)c2-c2cc(C)cc[n+]2C1C1C[n+]2cc(C)n(C)c2C(=O)O1 |
| InChI | InChI=1S/C26H29F2N3O2/c1-6-26(7-2)18-11-17(27)12-19(28)22(18)20-10-15(3)8-9-31(20)23(26)21-14-30-13-16(4)29(5)24(30)25(32)33-21/h8-13,21,23H,6-7,14H2,1-5H3/q+2 |
| InChIKey | NHRVRZUIIJBEGM-UHFFFAOYSA-N |
| XLogP | 4.01 |
| TPSA | 38.99 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 3 |
| Rotatable Bonds | 3 |
| Heavy Atoms | 33 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 453.53 |
| LogP ≤ 5 | 4.01 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 3 |
| Structural Alerts | {'alert_name': 'quaternary_nitrogen_1', 'substructure': 'N/A'} |
|---|