C24H22F5N3O2+2 — CID 90888177
6-[6,6-diethyl-9,11-difluoro-10-(trifluoromethyl)-7H-benzo[a]quinolizin-5-ium-7-yl]-5,6-dihydro-2H-imidazo[5,1-c][1,4]oxazin-4-ium-8-one (PubChem CID 90888177) has the molecular formula C24H22F5N3O2+2 and a molecular weight of 479.45 g/mol. Its IUPAC name is 6-[6,6-diethyl-9,11-difluoro-10-(trifluoromethyl)-7H-benzo[a]quinolizin-5-ium-7-yl]-5,6-dihydro-2H-imidazo[5,1-c][1,4]oxazin-4-ium-8-one.
| Compound Name | 6-[6,6-diethyl-9,11-difluoro-10-(trifluoromethyl)-7H-benzo[a]quinolizin-5-ium-7-yl]-5,6-dihydro-2H-imidazo[5,1-c][1,4]oxazin-4-ium-8-one |
|---|---|
| PubChem CID | 90888177 |
| Molecular Formula | C24H22F5N3O2+2 |
| Molecular Weight | 479.45 g/mol |
| Exact Mass | 479.16 |
| IUPAC Name | 6-[6,6-diethyl-9,11-difluoro-10-(trifluoromethyl)-7H-benzo[a]quinolizin-5-ium-7-yl]-5,6-dihydro-2H-imidazo[5,1-c][1,4]oxazin-4-ium-8-one |
| SMILES | CCC1(CC)C(C2C[n+]3c[nH]cc3C(=O)O2)c2cc(F)c(C(F)(F)F)c(F)c2-c2cccc[n+]21 |
| InChI | InChI=1S/C24H21F5N3O2/c1-3-23(4-2)19(17-11-31-12-30-10-16(31)22(33)34-17)13-9-14(25)20(24(27,28)29)21(26)18(13)15-7-5-6-8-32(15)23/h5-10,12,17,19H,3-4,11H2,1-2H3/q+1/p+1 |
| InChIKey | XQWJCIGIMURFGV-UHFFFAOYSA-O |
| XLogP | 4.41 |
| TPSA | 49.85 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 2 |
| Rotatable Bonds | 3 |
| Heavy Atoms | 34 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 479.45 |
| LogP ≤ 5 | 4.41 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 2 |
| Structural Alerts | {'alert_name': 'quaternary_nitrogen_1', 'substructure': 'N/A'} |
|---|