C31H36F5N3O2+2 — CID 90893262
[8,8-diethyl-10,12-difluoro-2-hexyl-11-(trifluoromethyl)pyrido[2,1-a][2]benzazepin-5-ium-7-yl] 2,3-dimethyl-1H-imidazol-3-ium-4-carboxylate (PubChem CID 90893262) has the molecular formula C31H36F5N3O2+2 and a molecular weight of 577.64 g/mol. Its IUPAC name is [8,8-diethyl-10,12-difluoro-2-hexyl-11-(trifluoromethyl)pyrido[2,1-a][2]benzazepin-5-ium-7-yl] 2,3-dimethyl-1H-imidazol-3-ium-4-carboxylate.
| Compound Name | [8,8-diethyl-10,12-difluoro-2-hexyl-11-(trifluoromethyl)pyrido[2,1-a][2]benzazepin-5-ium-7-yl] 2,3-dimethyl-1H-imidazol-3-ium-4-carboxylate |
|---|---|
| PubChem CID | 90893262 |
| Molecular Formula | C31H36F5N3O2+2 |
| Molecular Weight | 577.64 g/mol |
| Exact Mass | 577.27 |
| IUPAC Name | [8,8-diethyl-10,12-difluoro-2-hexyl-11-(trifluoromethyl)pyrido[2,1-a][2]benzazepin-5-ium-7-yl] 2,3-dimethyl-1H-imidazol-3-ium-4-carboxylate |
| SMILES | CCCCCCc1cc[n+]2c(c1)-c1c(cc(F)c(C(F)(F)F)c1F)C(CC)(CC)C(OC(=O)c1c[nH]c(C)[n+]1C)=C2 |
| InChI | InChI=1S/C31H35F5N3O2/c1-6-9-10-11-12-20-13-14-39-18-25(41-29(40)24-17-37-19(4)38(24)5)30(7-2,8-3)21-16-22(32)27(31(34,35)36)28(33)26(21)23(39)15-20/h13-18H,6-12H2,1-5H3/q+1/p+1 |
| InChIKey | BQWUJWGKMGYPEI-UHFFFAOYSA-O |
| XLogP | 7.25 |
| TPSA | 49.85 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 2 |
| Rotatable Bonds | 9 |
| Heavy Atoms | 41 |
| Complexity | — |
2 violations
| Rule | Value |
|---|---|
| MW ≤ 500 | 577.64 |
| LogP ≤ 5 | 7.25 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 2 |
| Structural Alerts | {'alert_name': 'Aliphatic_long_chain', 'substructure': 'N/A'}, {'alert_name': 'quaternary_nitrogen_1', 'substructure': 'N/A'} |
|---|