C25H20F5N3O2+2 — CID 91228393
6-[7,9-difluoro-4-methyl-2-prop-1-en-2-yl-8-(trifluoromethyl)-1-azoniatetracyclo[9.4.0.02,4.05,10]pentadeca-1(15),5,7,9,11,13-hexaen-3-yl]-5,6-dihydro-2H-imidazo[5,1-c][1,4]oxazin-4-ium-8-one (PubChem CID 91228393) has the molecular formula C25H20F5N3O2+2 and a molecular weight of 489.44 g/mol. Its IUPAC name is 6-[7,9-difluoro-4-methyl-2-prop-1-en-2-yl-8-(trifluoromethyl)-1-azoniatetracyclo[9.4.0.02,4.05,10]pentadeca-1(15),5,7,9,11,13-hexaen-3-yl]-5,6-dihydro-2H-imidazo[5,1-c][1,4]oxazin-4-ium-8-one.
| Compound Name | 6-[7,9-difluoro-4-methyl-2-prop-1-en-2-yl-8-(trifluoromethyl)-1-azoniatetracyclo[9.4.0.02,4.05,10]pentadeca-1(15),5,7,9,11,13-hexaen-3-yl]-5,6-dihydro-2H-imidazo[5,1-c][1,4]oxazin-4-ium-8-one |
|---|---|
| PubChem CID | 91228393 |
| Molecular Formula | C25H20F5N3O2+2 |
| Molecular Weight | 489.44 g/mol |
| Exact Mass | 489.15 |
| IUPAC Name | 6-[7,9-difluoro-4-methyl-2-prop-1-en-2-yl-8-(trifluoromethyl)-1-azoniatetracyclo[9.4.0.02,4.05,10]pentadeca-1(15),5,7,9,11,13-hexaen-3-yl]-5,6-dihydro-2H-imidazo[5,1-c][1,4]oxazin-4-ium-8-one |
| SMILES | C=C(C)C12C(C3C[n+]4c[nH]cc4C(=O)O3)C1(C)c1cc(F)c(C(F)(F)F)c(F)c1-c1cccc[n+]12 |
| InChI | InChI=1S/C25H19F5N3O2/c1-12(2)24-21(17-10-32-11-31-9-16(32)22(34)35-17)23(24,3)13-8-14(26)19(25(28,29)30)20(27)18(13)15-6-4-5-7-33(15)24/h4-9,11,17,21H,1,10H2,2-3H3/q+1/p+1 |
| InChIKey | HDDGCASNOMYWMX-UHFFFAOYSA-O |
| XLogP | 3.97 |
| TPSA | 49.85 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 2 |
| Rotatable Bonds | 2 |
| Heavy Atoms | 35 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 489.44 |
| LogP ≤ 5 | 3.97 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 2 |
| Structural Alerts | {'alert_name': 'isolated_alkene', 'substructure': 'N/A'}, {'alert_name': 'quaternary_nitrogen_1', 'substructure': 'N/A'} |
|---|