C26H24F2N4O2+2 — CID 90983417
3-(1,2-dimethyl-8-oxo-5,6-dihydroimidazo[2,1-c][1,4]oxazin-4-ium-6-yl)-4-ethyl-7,9-difluoro-2-methyl-1-azoniatetracyclo[9.4.0.02,4.05,10]pentadeca-1(15),5,7,9,11,13-hexaene-8-carbonitrile (PubChem CID 90983417) has the molecular formula C26H24F2N4O2+2 and a molecular weight of 462.50 g/mol. Its IUPAC name is 3-(1,2-dimethyl-8-oxo-5,6-dihydroimidazo[2,1-c][1,4]oxazin-4-ium-6-yl)-4-ethyl-7,9-difluoro-2-methyl-1-azoniatetracyclo[9.4.0.02,4.05,10]pentadeca-1(15),5,7,9,11,13-hexaene-8-carbonitrile.
| Compound Name | 3-(1,2-dimethyl-8-oxo-5,6-dihydroimidazo[2,1-c][1,4]oxazin-4-ium-6-yl)-4-ethyl-7,9-difluoro-2-methyl-1-azoniatetracyclo[9.4.0.02,4.05,10]pentadeca-1(15),5,7,9,11,13-hexaene-8-carbonitrile |
|---|---|
| PubChem CID | 90983417 |
| Molecular Formula | C26H24F2N4O2+2 |
| Molecular Weight | 462.50 g/mol |
| Exact Mass | 462.19 |
| IUPAC Name | 3-(1,2-dimethyl-8-oxo-5,6-dihydroimidazo[2,1-c][1,4]oxazin-4-ium-6-yl)-4-ethyl-7,9-difluoro-2-methyl-1-azoniatetracyclo[9.4.0.02,4.05,10]pentadeca-1(15),5,7,9,11,13-hexaene-8-carbonitrile |
| SMILES | CCC12c3cc(F)c(C#N)c(F)c3-c3cccc[n+]3C1(C)C2C1C[n+]2cc(C)n(C)c2C(=O)O1 |
| InChI | InChI=1S/C26H24F2N4O2/c1-5-26-16-10-17(27)15(11-29)21(28)20(16)18-8-6-7-9-32(18)25(26,3)22(26)19-13-31-12-14(2)30(4)23(31)24(33)34-19/h6-10,12,19,22H,5,13H2,1-4H3/q+2 |
| InChIKey | FWCSLNGHOAOEIC-UHFFFAOYSA-N |
| XLogP | 2.97 |
| TPSA | 62.78 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 4 |
| Rotatable Bonds | 2 |
| Heavy Atoms | 34 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 462.50 |
| LogP ≤ 5 | 2.97 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 4 |
| Structural Alerts | {'alert_name': 'quaternary_nitrogen_1', 'substructure': 'N/A'} |
|---|