C35H44F2N4O2+2 — CID 91391268
2-[10-cyano-6-ethenyl-6-ethyl-9,11-difluoro-2-(4-methyloctyl)-7H-benzo[a]quinolizin-5-ium-7-yl]ethyl 1,3-dimethylimidazol-1-ium-2-carboxylate (PubChem CID 91391268) has the molecular formula C35H44F2N4O2+2 and a molecular weight of 590.76 g/mol. Its IUPAC name is 2-[10-cyano-6-ethenyl-6-ethyl-9,11-difluoro-2-(4-methyloctyl)-7H-benzo[a]quinolizin-5-ium-7-yl]ethyl 1,3-dimethylimidazol-1-ium-2-carboxylate.
| Compound Name | 2-[10-cyano-6-ethenyl-6-ethyl-9,11-difluoro-2-(4-methyloctyl)-7H-benzo[a]quinolizin-5-ium-7-yl]ethyl 1,3-dimethylimidazol-1-ium-2-carboxylate |
|---|---|
| PubChem CID | 91391268 |
| Molecular Formula | C35H44F2N4O2+2 |
| Molecular Weight | 590.76 g/mol |
| Exact Mass | 590.34 |
| IUPAC Name | 2-[10-cyano-6-ethenyl-6-ethyl-9,11-difluoro-2-(4-methyloctyl)-7H-benzo[a]quinolizin-5-ium-7-yl]ethyl 1,3-dimethylimidazol-1-ium-2-carboxylate |
| SMILES | C=CC1(CC)C(CCOC(=O)c2n(C)cc[n+]2C)c2cc(F)c(C#N)c(F)c2-c2cc(CCCC(C)CCCC)cc[n+]21 |
| InChI | InChI=1S/C35H44F2N4O2/c1-7-10-12-24(4)13-11-14-25-15-17-41-30(21-25)31-26(22-29(36)27(23-38)32(31)37)28(35(41,8-2)9-3)16-20-43-34(42)33-39(5)18-19-40(33)6/h8,15,17-19,21-22,24,28H,2,7,9-14,16,20H2,1,3-6H3/q+2 |
| InChIKey | PPUPPLRUEWEJRP-UHFFFAOYSA-N |
| XLogP | 6.74 |
| TPSA | 62.78 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 4 |
| Rotatable Bonds | 13 |
| Heavy Atoms | 43 |
| Complexity | — |
2 violations
| Rule | Value |
|---|---|
| MW ≤ 500 | 590.76 |
| LogP ≤ 5 | 6.74 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 4 |
| Structural Alerts | {'alert_name': 'isolated_alkene', 'substructure': 'N/A'}, {'alert_name': 'quaternary_nitrogen_1', 'substructure': 'N/A'} |
|---|