C24H22F2N4O2+2 — CID 91046416
6-ethyl-10,12-difluoro-6-methyl-8-(8-oxo-5,6-dihydro-1H-imidazo[2,1-c][1,4]oxazin-4-ium-6-yl)-7,8-dihydropyrido[2,1-a][2]benzazepin-5-ium-11-carbonitrile (PubChem CID 91046416) has the molecular formula C24H22F2N4O2+2 and a molecular weight of 436.46 g/mol. Its IUPAC name is 6-ethyl-10,12-difluoro-6-methyl-8-(8-oxo-5,6-dihydro-1H-imidazo[2,1-c][1,4]oxazin-4-ium-6-yl)-7,8-dihydropyrido[2,1-a][2]benzazepin-5-ium-11-carbonitrile.
| Compound Name | 6-ethyl-10,12-difluoro-6-methyl-8-(8-oxo-5,6-dihydro-1H-imidazo[2,1-c][1,4]oxazin-4-ium-6-yl)-7,8-dihydropyrido[2,1-a][2]benzazepin-5-ium-11-carbonitrile |
|---|---|
| PubChem CID | 91046416 |
| Molecular Formula | C24H22F2N4O2+2 |
| Molecular Weight | 436.46 g/mol |
| Exact Mass | 436.17 |
| IUPAC Name | 6-ethyl-10,12-difluoro-6-methyl-8-(8-oxo-5,6-dihydro-1H-imidazo[2,1-c][1,4]oxazin-4-ium-6-yl)-7,8-dihydropyrido[2,1-a][2]benzazepin-5-ium-11-carbonitrile |
| SMILES | CCC1(C)CC(C2C[n+]3cc[nH]c3C(=O)O2)c2cc(F)c(C#N)c(F)c2-c2cccc[n+]21 |
| InChI | InChI=1S/C24H21F2N4O2/c1-3-24(2)11-15(19-13-29-9-7-28-22(29)23(31)32-19)14-10-17(25)16(12-27)21(26)20(14)18-6-4-5-8-30(18)24/h4-10,15,19H,3,11,13H2,1-2H3/q+1/p+1 |
| InChIKey | IAEGRKBBGNXKOI-UHFFFAOYSA-O |
| XLogP | 3.26 |
| TPSA | 73.64 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 3 |
| Rotatable Bonds | 2 |
| Heavy Atoms | 32 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 436.46 |
| LogP ≤ 5 | 3.26 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 3 |
| Structural Alerts | {'alert_name': 'quaternary_nitrogen_1', 'substructure': 'N/A'} |
|---|