C25H27F2N3O2+2 — CID 91588536
6-(10,12-difluoro-2,6-dimethyl-6-propyl-7,8-dihydropyrido[2,1-a][2]benzazepin-5-ium-8-yl)-5,6-dihydro-1H-imidazo[2,1-c][1,4]oxazin-4-ium-8-one (PubChem CID 91588536) has the molecular formula C25H27F2N3O2+2 and a molecular weight of 439.51 g/mol. Its IUPAC name is 6-(10,12-difluoro-2,6-dimethyl-6-propyl-7,8-dihydropyrido[2,1-a][2]benzazepin-5-ium-8-yl)-5,6-dihydro-1H-imidazo[2,1-c][1,4]oxazin-4-ium-8-one.
| Compound Name | 6-(10,12-difluoro-2,6-dimethyl-6-propyl-7,8-dihydropyrido[2,1-a][2]benzazepin-5-ium-8-yl)-5,6-dihydro-1H-imidazo[2,1-c][1,4]oxazin-4-ium-8-one |
|---|---|
| PubChem CID | 91588536 |
| Molecular Formula | C25H27F2N3O2+2 |
| Molecular Weight | 439.51 g/mol |
| Exact Mass | 439.21 |
| IUPAC Name | 6-(10,12-difluoro-2,6-dimethyl-6-propyl-7,8-dihydropyrido[2,1-a][2]benzazepin-5-ium-8-yl)-5,6-dihydro-1H-imidazo[2,1-c][1,4]oxazin-4-ium-8-one |
| SMILES | CCCC1(C)CC(C2C[n+]3cc[nH]c3C(=O)O2)c2cc(F)cc(F)c2-c2cc(C)cc[n+]21 |
| InChI | InChI=1S/C25H26F2N3O2/c1-4-6-25(3)13-18(21-14-29-9-7-28-23(29)24(31)32-21)17-11-16(26)12-19(27)22(17)20-10-15(2)5-8-30(20)25/h5,7-12,18,21H,4,6,13-14H2,1-3H3/q+1/p+1 |
| InChIKey | RBPAFYRUHGXOCB-UHFFFAOYSA-O |
| XLogP | 4.09 |
| TPSA | 49.85 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 2 |
| Rotatable Bonds | 3 |
| Heavy Atoms | 32 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 439.51 |
| LogP ≤ 5 | 4.09 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 2 |
| Structural Alerts | {'alert_name': 'quaternary_nitrogen_1', 'substructure': 'N/A'} |
|---|