C28H33F2N3O2+2 — CID 91280179
6-(6,6-diethyl-10,12-difluoro-2,11-dimethyl-7,8-dihydropyrido[2,1-a][2]benzazepin-5-ium-8-yl)-2,3-dimethyl-5,6-dihydroimidazo[5,1-c][1,4]oxazin-2-ium-8-one (PubChem CID 91280179) has the molecular formula C28H33F2N3O2+2 and a molecular weight of 481.59 g/mol. Its IUPAC name is 6-(6,6-diethyl-10,12-difluoro-2,11-dimethyl-7,8-dihydropyrido[2,1-a][2]benzazepin-5-ium-8-yl)-2,3-dimethyl-5,6-dihydroimidazo[5,1-c][1,4]oxazin-2-ium-8-one.
| Compound Name | 6-(6,6-diethyl-10,12-difluoro-2,11-dimethyl-7,8-dihydropyrido[2,1-a][2]benzazepin-5-ium-8-yl)-2,3-dimethyl-5,6-dihydroimidazo[5,1-c][1,4]oxazin-2-ium-8-one |
|---|---|
| PubChem CID | 91280179 |
| Molecular Formula | C28H33F2N3O2+2 |
| Molecular Weight | 481.59 g/mol |
| Exact Mass | 481.25 |
| IUPAC Name | 6-(6,6-diethyl-10,12-difluoro-2,11-dimethyl-7,8-dihydropyrido[2,1-a][2]benzazepin-5-ium-8-yl)-2,3-dimethyl-5,6-dihydroimidazo[5,1-c][1,4]oxazin-2-ium-8-one |
| SMILES | CCC1(CC)CC(C2Cn3c(c[n+](C)c3C)C(=O)O2)c2cc(F)c(C)c(F)c2-c2cc(C)cc[n+]21 |
| InChI | InChI=1S/C28H33F2N3O2/c1-7-28(8-2)13-20(24-15-32-18(5)31(6)14-23(32)27(34)35-24)19-12-21(29)17(4)26(30)25(19)22-11-16(3)9-10-33(22)28/h9-12,14,20,24H,7-8,13,15H2,1-6H3/q+2 |
| InChIKey | TVGXGFQFPPTUQE-UHFFFAOYSA-N |
| XLogP | 4.71 |
| TPSA | 38.99 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 3 |
| Rotatable Bonds | 3 |
| Heavy Atoms | 35 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 481.59 |
| LogP ≤ 5 | 4.71 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 3 |
| Structural Alerts | {'alert_name': 'quaternary_nitrogen_1', 'substructure': 'N/A'} |
|---|