C28H30F5N3O2+2 — CID 91240005
6-ethyl-9,11-difluoro-2-hexyl-1',6-dimethyl-10-(trifluoromethyl)spiro[benzo[a]quinolizin-5-ium-7,5'-imidazo[1,2-c][1,3]oxazol-1-ium]-7'-one (PubChem CID 91240005) has the molecular formula C28H30F5N3O2+2 and a molecular weight of 535.56 g/mol. Its IUPAC name is 6-ethyl-9,11-difluoro-2-hexyl-1',6-dimethyl-10-(trifluoromethyl)spiro[benzo[a]quinolizin-5-ium-7,5'-imidazo[1,2-c][1,3]oxazol-1-ium]-7'-one.
| Compound Name | 6-ethyl-9,11-difluoro-2-hexyl-1',6-dimethyl-10-(trifluoromethyl)spiro[benzo[a]quinolizin-5-ium-7,5'-imidazo[1,2-c][1,3]oxazol-1-ium]-7'-one |
|---|---|
| PubChem CID | 91240005 |
| Molecular Formula | C28H30F5N3O2+2 |
| Molecular Weight | 535.56 g/mol |
| Exact Mass | 535.22 |
| IUPAC Name | 6-ethyl-9,11-difluoro-2-hexyl-1',6-dimethyl-10-(trifluoromethyl)spiro[benzo[a]quinolizin-5-ium-7,5'-imidazo[1,2-c][1,3]oxazol-1-ium]-7'-one |
| SMILES | CCCCCCc1cc[n+]2c(c1)-c1c(cc(F)c(C(F)(F)F)c1F)C1(OC(=O)c3n1cc[n+]3C)C2(C)CC |
| InChI | InChI=1S/C28H30F5N3O2/c1-5-7-8-9-10-17-11-12-35-20(15-17)21-18(16-19(29)22(23(21)30)28(31,32)33)27(26(35,3)6-2)36-14-13-34(4)24(36)25(37)38-27/h11-16H,5-10H2,1-4H3/q+2 |
| InChIKey | ZVNLOMZFAZNGIR-UHFFFAOYSA-N |
| XLogP | 5.70 |
| TPSA | 38.99 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 3 |
| Rotatable Bonds | 6 |
| Heavy Atoms | 38 |
| Complexity | — |
2 violations
| Rule | Value |
|---|---|
| MW ≤ 500 | 535.56 |
| LogP ≤ 5 | 5.70 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 3 |
| Structural Alerts | {'alert_name': 'Aliphatic_long_chain', 'substructure': 'N/A'}, {'alert_name': 'quaternary_nitrogen_1', 'substructure': 'N/A'} |
|---|