About 1-(2,5-diethyldecyl)-2-propylcyclopropane
1-(2,5-diethyldecyl)-2-propylcyclopropane (PubChem CID 90691022) has the molecular formula C20H40
and a molecular weight of 280.54 g/mol. Its IUPAC name is 1-(2,5-diethyldecyl)-2-propylcyclopropane.
Molecular Properties
| Compound Name | 1-(2,5-diethyldecyl)-2-propylcyclopropane |
| PubChem CID | 90691022 |
| Molecular Formula | C20H40 |
| Molecular Weight | 280.54 g/mol |
| Exact Mass | 280.31 |
| IUPAC Name | 1-(2,5-diethyldecyl)-2-propylcyclopropane |
| SMILES | CCCCCC(CC)CCC(CC)CC1CC1CCC |
| InChI | InChI=1S/C20H40/c1-5-9-10-12-17(7-3)13-14-18(8-4)15-20-16-19(20)11-6-2/h17-20H,5-16H2,1-4H3 |
| InChIKey | QWCZTCYFVOXJCV-UHFFFAOYSA-N |
| XLogP | 7.23 |
| TPSA | 0.00 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | |
| Rotatable Bonds | 13 |
| Heavy Atoms | 20 |
| Complexity | — |
Lipinski Rule of Five
1 violation
| Rule | Value |
| MW ≤ 500 | 280.54 |
| LogP ≤ 5 | 7.23 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 0 |
Computed Properties (RDKit)
| Structural Alerts | {'alert_name': 'Aliphatic_long_chain', 'substructure': 'N/A'} |
|---|
Analyze 1-(2,5-diethyldecyl)-2-propylcyclopropane with MolForge
Explore ADMET properties, 3D molecular structure, drug-likeness score, and discover similar compounds using our AI-powered platform.
Launch Full Analysis
Frequently Asked Questions
What is the IUPAC name of 1-(2,5-diethyldecyl)-2-propylcyclopropane?
The IUPAC name of 1-(2,5-diethyldecyl)-2-propylcyclopropane (CID 90691022) is 1-(2,5-diethyldecyl)-2-propylcyclopropane.
What is the SMILES notation for 1-(2,5-diethyldecyl)-2-propylcyclopropane?
The canonical SMILES for 1-(2,5-diethyldecyl)-2-propylcyclopropane is CCCCCC(CC)CCC(CC)CC1CC1CCC.
What is the InChIKey of 1-(2,5-diethyldecyl)-2-propylcyclopropane?
The InChIKey is QWCZTCYFVOXJCV-UHFFFAOYSA-N. The full InChI is InChI=1S/C20H40/c1-5-9-10-12-17(7-3)13-14-18(8-4)15-20-16-19(20)11-6-2/h17-20H,5-16H2,1-4H3.
What are the key properties of 1-(2,5-diethyldecyl)-2-propylcyclopropane?
1-(2,5-diethyldecyl)-2-propylcyclopropane has a molecular weight of 280.54 g/mol, XLogP of 7.23, 13 rotatable bonds, 0 hydrogen bond donors, and 0 hydrogen bond acceptors.
Where does this data come from?
All data for 1-(2,5-diethyldecyl)-2-propylcyclopropane is sourced from PubChem (CID 90691022), the world's largest open chemistry database maintained by the National Library of Medicine (NIH).