C38H30F3N3 — CID 90693710
4-[(Z)-[benzyl(phenyl)hydrazinylidene]methyl]-N-(4-methylphenyl)-N-[3-(trifluoromethyl)phenyl]naphthalen-1-amine (PubChem CID 90693710) has the molecular formula C38H30F3N3 and a molecular weight of 585.67 g/mol. Its IUPAC name is 4-[(Z)-[benzyl(phenyl)hydrazinylidene]methyl]-N-(4-methylphenyl)-N-[3-(trifluoromethyl)phenyl]naphthalen-1-amine.
| Compound Name | 4-[(Z)-[benzyl(phenyl)hydrazinylidene]methyl]-N-(4-methylphenyl)-N-[3-(trifluoromethyl)phenyl]naphthalen-1-amine |
|---|---|
| PubChem CID | 90693710 |
| Molecular Formula | C38H30F3N3 |
| Molecular Weight | 585.67 g/mol |
| Exact Mass | 585.24 |
| IUPAC Name | 4-[(Z)-[benzyl(phenyl)hydrazinylidene]methyl]-N-(4-methylphenyl)-N-[3-(trifluoromethyl)phenyl]naphthalen-1-amine |
| SMILES | Cc1ccc(N(c2cccc(C(F)(F)F)c2)c2ccc(/C=N\N(Cc3ccccc3)c3ccccc3)c3ccccc23)cc1 |
| InChI | InChI=1S/C38H30F3N3/c1-28-19-22-33(23-20-28)44(34-16-10-13-31(25-34)38(39,40)41)37-24-21-30(35-17-8-9-18-36(35)37)26-42-43(32-14-6-3-7-15-32)27-29-11-4-2-5-12-29/h2-26H,27H2,1H3/b42-26- |
| InChIKey | CJYTYWFVNAYBKP-LLWBAHTNSA-N |
| XLogP | 10.68 |
| TPSA | 18.84 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 3 |
| Rotatable Bonds | 8 |
| Heavy Atoms | 44 |
| Complexity | — |
2 violations
| Rule | Value |
|---|---|
| MW ≤ 500 | 585.67 |
| LogP ≤ 5 | 10.68 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 3 |
| Structural Alerts | {'alert_name': 'imine_1', 'substructure': 'N/A'}, {'alert_name': 'Oxygen-nitrogen_single_bond', 'substructure': 'N/A'} |
|---|