C22H21F2N3O2 — CID 90693847
5-(ethylamino)-7-(2-fluoroethyl)-3-[(4-fluorophenyl)methyl]pyrrolo[3,4-g]quinoline-8,9-diol (PubChem CID 90693847) has the molecular formula C22H21F2N3O2 and a molecular weight of 397.43 g/mol. Its IUPAC name is 5-(ethylamino)-7-(2-fluoroethyl)-3-[(4-fluorophenyl)methyl]pyrrolo[3,4-g]quinoline-8,9-diol.
| Compound Name | 5-(ethylamino)-7-(2-fluoroethyl)-3-[(4-fluorophenyl)methyl]pyrrolo[3,4-g]quinoline-8,9-diol |
|---|---|
| PubChem CID | 90693847 |
| Molecular Formula | C22H21F2N3O2 |
| Molecular Weight | 397.43 g/mol |
| Exact Mass | 397.16 |
| IUPAC Name | 5-(ethylamino)-7-(2-fluoroethyl)-3-[(4-fluorophenyl)methyl]pyrrolo[3,4-g]quinoline-8,9-diol |
| SMILES | CCNc1c2cc(Cc3ccc(F)cc3)cnc2c(O)c2c(O)n(CCF)cc12 |
| InChI | InChI=1S/C22H21F2N3O2/c1-2-25-19-16-10-14(9-13-3-5-15(24)6-4-13)11-26-20(16)21(28)18-17(19)12-27(8-7-23)22(18)29/h3-6,10-12,25,28-29H,2,7-9H2,1H3 |
| InChIKey | QJIDCVMTFBDZRH-UHFFFAOYSA-N |
| XLogP | 4.73 |
| TPSA | 70.31 Ų |
| H-Bond Donors | 3 |
| H-Bond Acceptors | 5 |
| Rotatable Bonds | 6 |
| Heavy Atoms | 29 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 397.43 |
| LogP ≤ 5 | 4.73 |
| H-Bond Donors ≤ 5 | 3 |
| H-Bond Acceptors ≤ 10 | 5 |
| Structural Alerts | {'alert_name': 'hydroquinone', 'substructure': 'N/A'} |
|---|