C10H12BrNO — CID 90694027
5-bromo-3-methyl-2,1-benzoxazole;ethane (PubChem CID 90694027) has the molecular formula C10H12BrNO and a molecular weight of 242.12 g/mol. Its IUPAC name is 5-bromo-3-methyl-2,1-benzoxazole;ethane.
| Compound Name | 5-bromo-3-methyl-2,1-benzoxazole;ethane |
|---|---|
| PubChem CID | 90694027 |
| Molecular Formula | C10H12BrNO |
| Molecular Weight | 242.12 g/mol |
| Exact Mass | 241.01 |
| IUPAC Name | 5-bromo-3-methyl-2,1-benzoxazole;ethane |
| SMILES | CC.Cc1onc2ccc(Br)cc12 |
| InChI | InChI=1S/C8H6BrNO.C2H6/c1-5-7-4-6(9)2-3-8(7)10-11-5;1-2/h2-4H,1H3;1-2H3 |
| InChIKey | OMNVQEKKDTXAGN-UHFFFAOYSA-N |
| XLogP | 3.92 |
| TPSA | 26.03 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 2 |
| Rotatable Bonds | |
| Heavy Atoms | 13 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 242.12 |
| LogP ≤ 5 | 3.92 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 2 |