C10H14ClF2N5 — CID 90694035
2-chloro-4-N-(4,4-difluorocyclohexyl)pyrimidine-4,5,6-triamine (PubChem CID 90694035) has the molecular formula C10H14ClF2N5 and a molecular weight of 277.71 g/mol. Its IUPAC name is 2-chloro-4-N-(4,4-difluorocyclohexyl)pyrimidine-4,5,6-triamine.
| Compound Name | 2-chloro-4-N-(4,4-difluorocyclohexyl)pyrimidine-4,5,6-triamine |
|---|---|
| PubChem CID | 90694035 |
| Molecular Formula | C10H14ClF2N5 |
| Molecular Weight | 277.71 g/mol |
| Exact Mass | 277.09 |
| IUPAC Name | 2-chloro-4-N-(4,4-difluorocyclohexyl)pyrimidine-4,5,6-triamine |
| SMILES | Nc1nc(Cl)nc(NC2CCC(F)(F)CC2)c1N |
| InChI | InChI=1S/C10H14ClF2N5/c11-9-17-7(15)6(14)8(18-9)16-5-1-3-10(12,13)4-2-5/h5H,1-4,14H2,(H3,15,16,17,18) |
| InChIKey | CDPPWILIGHQDPZ-UHFFFAOYSA-N |
| XLogP | 2.28 |
| TPSA | 89.85 Ų |
| H-Bond Donors | 3 |
| H-Bond Acceptors | 5 |
| Rotatable Bonds | 2 |
| Heavy Atoms | 18 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 277.71 |
| LogP ≤ 5 | 2.28 |
| H-Bond Donors ≤ 5 | 3 |
| H-Bond Acceptors ≤ 10 | 5 |