About 8-bromo-2-[3-(trifluoromethyl)phenyl]-4H-pyrido[4,3-d][1,3]oxazine
8-bromo-2-[3-(trifluoromethyl)phenyl]-4H-pyrido[4,3-d][1,3]oxazine (PubChem CID 90695721) has the molecular formula C14H8BrF3N2O
and a molecular weight of 357.13 g/mol. Its IUPAC name is 8-bromo-2-[3-(trifluoromethyl)phenyl]-4H-pyrido[4,3-d][1,3]oxazine.
Molecular Properties
| Compound Name | 8-bromo-2-[3-(trifluoromethyl)phenyl]-4H-pyrido[4,3-d][1,3]oxazine |
| PubChem CID | 90695721 |
| Molecular Formula | C14H8BrF3N2O |
| Molecular Weight | 357.13 g/mol |
| Exact Mass | 355.98 |
| IUPAC Name | 8-bromo-2-[3-(trifluoromethyl)phenyl]-4H-pyrido[4,3-d][1,3]oxazine |
| SMILES | FC(F)(F)c1cccc(C2=Nc3c(Br)cncc3CO2)c1 |
| InChI | InChI=1S/C14H8BrF3N2O/c15-11-6-19-5-9-7-21-13(20-12(9)11)8-2-1-3-10(4-8)14(16,17)18/h1-6H,7H2 |
| InChIKey | MOTNZKWWRDXFKW-UHFFFAOYSA-N |
| XLogP | 4.47 |
| TPSA | 34.48 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 3 |
| Rotatable Bonds | 1 |
| Heavy Atoms | 21 |
| Complexity | — |
Lipinski Rule of Five
Passes Rule of Five
| Rule | Value |
| MW ≤ 500 | 357.13 |
| LogP ≤ 5 | 4.47 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 3 |
Analyze 8-bromo-2-[3-(trifluoromethyl)phenyl]-4H-pyrido[4,3-d][1,3]oxazine with MolForge
Explore ADMET properties, 3D molecular structure, drug-likeness score, and discover similar compounds using our AI-powered platform.
Launch Full Analysis
Frequently Asked Questions
What is the IUPAC name of 8-bromo-2-[3-(trifluoromethyl)phenyl]-4H-pyrido[4,3-d][1,3]oxazine?
The IUPAC name of 8-bromo-2-[3-(trifluoromethyl)phenyl]-4H-pyrido[4,3-d][1,3]oxazine (CID 90695721) is 8-bromo-2-[3-(trifluoromethyl)phenyl]-4H-pyrido[4,3-d][1,3]oxazine.
What is the SMILES notation for 8-bromo-2-[3-(trifluoromethyl)phenyl]-4H-pyrido[4,3-d][1,3]oxazine?
The canonical SMILES for 8-bromo-2-[3-(trifluoromethyl)phenyl]-4H-pyrido[4,3-d][1,3]oxazine is FC(F)(F)c1cccc(C2=Nc3c(Br)cncc3CO2)c1.
What is the InChIKey of 8-bromo-2-[3-(trifluoromethyl)phenyl]-4H-pyrido[4,3-d][1,3]oxazine?
The InChIKey is MOTNZKWWRDXFKW-UHFFFAOYSA-N. The full InChI is InChI=1S/C14H8BrF3N2O/c15-11-6-19-5-9-7-21-13(20-12(9)11)8-2-1-3-10(4-8)14(16,17)18/h1-6H,7H2.
What are the key properties of 8-bromo-2-[3-(trifluoromethyl)phenyl]-4H-pyrido[4,3-d][1,3]oxazine?
8-bromo-2-[3-(trifluoromethyl)phenyl]-4H-pyrido[4,3-d][1,3]oxazine has a molecular weight of 357.13 g/mol, XLogP of 4.47, 1 rotatable bonds, 0 hydrogen bond donors, and 3 hydrogen bond acceptors.
Where does this data come from?
All data for 8-bromo-2-[3-(trifluoromethyl)phenyl]-4H-pyrido[4,3-d][1,3]oxazine is sourced from PubChem (CID 90695721), the world's largest open chemistry database maintained by the National Library of Medicine (NIH).