C13H22N2 — CID 90696324
5-piperidin-1-yl-6-prop-2-enyl-2,3,4,5-tetrahydropyridine (PubChem CID 90696324) has the molecular formula C13H22N2 and a molecular weight of 206.33 g/mol. Its IUPAC name is 5-piperidin-1-yl-6-prop-2-enyl-2,3,4,5-tetrahydropyridine.
| Compound Name | 5-piperidin-1-yl-6-prop-2-enyl-2,3,4,5-tetrahydropyridine |
|---|---|
| PubChem CID | 90696324 |
| Molecular Formula | C13H22N2 |
| Molecular Weight | 206.33 g/mol |
| Exact Mass | 206.18 |
| IUPAC Name | 5-piperidin-1-yl-6-prop-2-enyl-2,3,4,5-tetrahydropyridine |
| SMILES | C=CCC1=NCCCC1N1CCCCC1 |
| InChI | InChI=1S/C13H22N2/c1-2-7-12-13(8-6-9-14-12)15-10-4-3-5-11-15/h2,13H,1,3-11H2 |
| InChIKey | DFGBUCQXBHAQCC-UHFFFAOYSA-N |
| XLogP | 2.65 |
| TPSA | 15.60 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 2 |
| Rotatable Bonds | 3 |
| Heavy Atoms | 15 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 206.33 |
| LogP ≤ 5 | 2.65 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 2 |
| Structural Alerts | {'alert_name': 'isolated_alkene', 'substructure': 'N/A'} |
|---|