C9H13N3 — CID 145255956
1-methyl-2,3,8,8a-tetrahydro-1,5-naphthyridin-4-imine (PubChem CID 145255956) has the molecular formula C9H13N3 and a molecular weight of 163.22 g/mol. Its IUPAC name is 1-methyl-2,3,8,8a-tetrahydro-1,5-naphthyridin-4-imine.
| Compound Name | 1-methyl-2,3,8,8a-tetrahydro-1,5-naphthyridin-4-imine |
|---|---|
| PubChem CID | 145255956 |
| Molecular Formula | C9H13N3 |
| Molecular Weight | 163.22 g/mol |
| Exact Mass | 163.11 |
| IUPAC Name | 1-methyl-2,3,8,8a-tetrahydro-1,5-naphthyridin-4-imine |
| SMILES | [H]/N=C1\CCN(C)C2CC=CN=C12 |
| InChI | InChI=1S/C9H13N3/c1-12-6-4-7(10)9-8(12)3-2-5-11-9/h2,5,8,10H,3-4,6H2,1H3/b10-7+ |
| InChIKey | BSSJHJSQZVTXLN-JXMROGBWSA-N |
| XLogP | 1.07 |
| TPSA | 39.45 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 3 |
| Rotatable Bonds | |
| Heavy Atoms | 12 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 163.22 |
| LogP ≤ 5 | 1.07 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 3 |
| Structural Alerts | {'alert_name': 'imine_1', 'substructure': 'N/A'} |
|---|