C19H35F3 — CID 90698740
2,4,8,8-tetramethyl-3-methylidene-6-propan-2-yl-4-(trifluoromethyl)decane (PubChem CID 90698740) has the molecular formula C19H35F3 and a molecular weight of 320.48 g/mol. Its IUPAC name is 2,4,8,8-tetramethyl-3-methylidene-6-propan-2-yl-4-(trifluoromethyl)decane.
| Compound Name | 2,4,8,8-tetramethyl-3-methylidene-6-propan-2-yl-4-(trifluoromethyl)decane |
|---|---|
| PubChem CID | 90698740 |
| Molecular Formula | C19H35F3 |
| Molecular Weight | 320.48 g/mol |
| Exact Mass | 320.27 |
| IUPAC Name | 2,4,8,8-tetramethyl-3-methylidene-6-propan-2-yl-4-(trifluoromethyl)decane |
| SMILES | C=C(C(C)C)C(C)(CC(CC(C)(C)CC)C(C)C)C(F)(F)F |
| InChI | InChI=1S/C19H35F3/c1-10-17(7,8)11-16(14(4)5)12-18(9,19(20,21)22)15(6)13(2)3/h13-14,16H,6,10-12H2,1-5,7-9H3 |
| InChIKey | AUQLQDFCNFPIHF-UHFFFAOYSA-N |
| XLogP | 7.26 |
| TPSA | 0.00 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | |
| Rotatable Bonds | 8 |
| Heavy Atoms | 22 |
| Complexity | — |
1 violation
| Rule | Value |
|---|---|
| MW ≤ 500 | 320.48 |
| LogP ≤ 5 | 7.26 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 0 |
| Structural Alerts | {'alert_name': 'isolated_alkene', 'substructure': 'N/A'} |
|---|