C11H21N5O — CID 90700982
(2R)-2-amino-N-(5-azidopent-1-enyl)-4-methylpentanamide (PubChem CID 90700982) has the molecular formula C11H21N5O and a molecular weight of 239.32 g/mol. Its IUPAC name is (2R)-2-amino-N-(5-azidopent-1-enyl)-4-methylpentanamide.
| Compound Name | (2R)-2-amino-N-(5-azidopent-1-enyl)-4-methylpentanamide |
|---|---|
| PubChem CID | 90700982 |
| Molecular Formula | C11H21N5O |
| Molecular Weight | 239.32 g/mol |
| Exact Mass | 239.17 |
| IUPAC Name | (2R)-2-amino-N-(5-azidopent-1-enyl)-4-methylpentanamide |
| SMILES | CC(C)C[C@@H](N)C(=O)NC=CCCCN=[N+]=[N-] |
| InChI | InChI=1S/C11H21N5O/c1-9(2)8-10(12)11(17)14-6-4-3-5-7-15-16-13/h4,6,9-10H,3,5,7-8,12H2,1-2H3,(H,14,17)/t10-/m1/s1 |
| InChIKey | NVLUBVMSTVUHHQ-SNVBAGLBSA-N |
| XLogP | 2.08 |
| TPSA | 103.88 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 3 |
| Rotatable Bonds | 8 |
| Heavy Atoms | 17 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 239.32 |
| LogP ≤ 5 | 2.08 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 3 |
| Structural Alerts | {'alert_name': 'azo_A(324)', 'substructure': 'N/A'}, {'alert_name': 'Aliphatic_long_chain', 'substructure': 'N/A'}, {'alert_name': 'Azido_group', 'substructure': 'N/A'}, {'alert_name': 'diazo_group', 'substructure': 'N/A'}, {'alert_name': 'quaternary_nitrogen_3', 'substructure': 'N/A'} |
|---|