C20H39NO — CID 90701433
1-(3,6-diethyl-3,6-dimethyloctan-4-yl)azepan-2-one (PubChem CID 90701433) has the molecular formula C20H39NO and a molecular weight of 309.54 g/mol. Its IUPAC name is 1-(3,6-diethyl-3,6-dimethyloctan-4-yl)azepan-2-one.
| Compound Name | 1-(3,6-diethyl-3,6-dimethyloctan-4-yl)azepan-2-one |
|---|---|
| PubChem CID | 90701433 |
| Molecular Formula | C20H39NO |
| Molecular Weight | 309.54 g/mol |
| Exact Mass | 309.30 |
| IUPAC Name | 1-(3,6-diethyl-3,6-dimethyloctan-4-yl)azepan-2-one |
| SMILES | CCC(C)(CC)CC(N1CCCCCC1=O)C(C)(CC)CC |
| InChI | InChI=1S/C20H39NO/c1-7-19(5,8-2)16-17(20(6,9-3)10-4)21-15-13-11-12-14-18(21)22/h17H,7-16H2,1-6H3 |
| InChIKey | ATQXQRNYYHOSMV-UHFFFAOYSA-N |
| XLogP | 5.80 |
| TPSA | 20.31 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 1 |
| Rotatable Bonds | 8 |
| Heavy Atoms | 22 |
| Complexity | — |
1 violation
| Rule | Value |
|---|---|
| MW ≤ 500 | 309.54 |
| LogP ≤ 5 | 5.80 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 1 |