C22H41NO — CID 163652018
1-[(Z)-5-ethyl-2,5,6,11-tetramethyldodec-8-en-3-yl]pyrrolidin-2-one (PubChem CID 163652018) has the molecular formula C22H41NO and a molecular weight of 335.58 g/mol. Its IUPAC name is 1-[(Z)-5-ethyl-2,5,6,11-tetramethyldodec-8-en-3-yl]pyrrolidin-2-one.
| Compound Name | 1-[(Z)-5-ethyl-2,5,6,11-tetramethyldodec-8-en-3-yl]pyrrolidin-2-one |
|---|---|
| PubChem CID | 163652018 |
| Molecular Formula | C22H41NO |
| Molecular Weight | 335.58 g/mol |
| Exact Mass | 335.32 |
| IUPAC Name | 1-[(Z)-5-ethyl-2,5,6,11-tetramethyldodec-8-en-3-yl]pyrrolidin-2-one |
| SMILES | CCC(C)(CC(C(C)C)N1CCCC1=O)C(C)C/C=C\CC(C)C |
| InChI | InChI=1S/C22H41NO/c1-8-22(7,19(6)13-10-9-12-17(2)3)16-20(18(4)5)23-15-11-14-21(23)24/h9-10,17-20H,8,11-16H2,1-7H3/b10-9- |
| InChIKey | IMZQFTUOWHCIRL-KTKRTIGZSA-N |
| XLogP | 6.07 |
| TPSA | 20.31 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 1 |
| Rotatable Bonds | 10 |
| Heavy Atoms | 24 |
| Complexity | — |
1 violation
| Rule | Value |
|---|---|
| MW ≤ 500 | 335.58 |
| LogP ≤ 5 | 6.07 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 1 |
| Structural Alerts | {'alert_name': 'isolated_alkene', 'substructure': 'N/A'} |
|---|