C22H24N2O3 — CID 90702828
benzyl 3-phenyl-1-oxa-2,9-diazaspiro[4.6]undec-3-ene-9-carboxylate (PubChem CID 90702828) has the molecular formula C22H24N2O3 and a molecular weight of 364.44 g/mol. Its IUPAC name is benzyl 3-phenyl-1-oxa-2,9-diazaspiro[4.6]undec-3-ene-9-carboxylate.
| Compound Name | benzyl 3-phenyl-1-oxa-2,9-diazaspiro[4.6]undec-3-ene-9-carboxylate |
|---|---|
| PubChem CID | 90702828 |
| Molecular Formula | C22H24N2O3 |
| Molecular Weight | 364.44 g/mol |
| Exact Mass | 364.18 |
| IUPAC Name | benzyl 3-phenyl-1-oxa-2,9-diazaspiro[4.6]undec-3-ene-9-carboxylate |
| SMILES | O=C(OCc1ccccc1)N1CCCC2(C=C(c3ccccc3)NO2)CC1 |
| InChI | InChI=1S/C22H24N2O3/c25-21(26-17-18-8-3-1-4-9-18)24-14-7-12-22(13-15-24)16-20(23-27-22)19-10-5-2-6-11-19/h1-6,8-11,16,23H,7,12-15,17H2 |
| InChIKey | OYCBVUBIGQLIAO-UHFFFAOYSA-N |
| XLogP | 4.12 |
| TPSA | 50.80 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 4 |
| Rotatable Bonds | 3 |
| Heavy Atoms | 27 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 364.44 |
| LogP ≤ 5 | 4.12 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 4 |