C15H15F3N2O4 — CID 90709312
4,5-dihydroxy-N-methoxy-1-methyl-N-[[4-(trifluoromethyl)phenyl]methyl]pyrrole-3-carboxamide (PubChem CID 90709312) has the molecular formula C15H15F3N2O4 and a molecular weight of 344.29 g/mol. Its IUPAC name is 4,5-dihydroxy-N-methoxy-1-methyl-N-[[4-(trifluoromethyl)phenyl]methyl]pyrrole-3-carboxamide.
| Compound Name | 4,5-dihydroxy-N-methoxy-1-methyl-N-[[4-(trifluoromethyl)phenyl]methyl]pyrrole-3-carboxamide |
|---|---|
| PubChem CID | 90709312 |
| Molecular Formula | C15H15F3N2O4 |
| Molecular Weight | 344.29 g/mol |
| Exact Mass | 344.10 |
| IUPAC Name | 4,5-dihydroxy-N-methoxy-1-methyl-N-[[4-(trifluoromethyl)phenyl]methyl]pyrrole-3-carboxamide |
| SMILES | CON(Cc1ccc(C(F)(F)F)cc1)C(=O)c1cn(C)c(O)c1O |
| InChI | InChI=1S/C15H15F3N2O4/c1-19-8-11(12(21)14(19)23)13(22)20(24-2)7-9-3-5-10(6-4-9)15(16,17)18/h3-6,8,21,23H,7H2,1-2H3 |
| InChIKey | CTGFFIKTHRAMJI-UHFFFAOYSA-N |
| XLogP | 2.66 |
| TPSA | 74.93 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 5 |
| Rotatable Bonds | 4 |
| Heavy Atoms | 24 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 344.29 |
| LogP ≤ 5 | 2.66 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 5 |
| Structural Alerts | {'alert_name': 'Oxygen-nitrogen_single_bond', 'substructure': 'N/A'} |
|---|