C22H25NO4 — CID 90712151
ethyl 2,6-dimethyl-5-(3-oxoprop-2-enoyl)-4-(2,4,6-trimethylphenyl)-3,4-dihydropyridine-3-carboxylate (PubChem CID 90712151) has the molecular formula C22H25NO4 and a molecular weight of 367.45 g/mol. Its IUPAC name is ethyl 2,6-dimethyl-5-(3-oxoprop-2-enoyl)-4-(2,4,6-trimethylphenyl)-3,4-dihydropyridine-3-carboxylate.
| Compound Name | ethyl 2,6-dimethyl-5-(3-oxoprop-2-enoyl)-4-(2,4,6-trimethylphenyl)-3,4-dihydropyridine-3-carboxylate |
|---|---|
| PubChem CID | 90712151 |
| Molecular Formula | C22H25NO4 |
| Molecular Weight | 367.45 g/mol |
| Exact Mass | 367.18 |
| IUPAC Name | ethyl 2,6-dimethyl-5-(3-oxoprop-2-enoyl)-4-(2,4,6-trimethylphenyl)-3,4-dihydropyridine-3-carboxylate |
| SMILES | CCOC(=O)C1C(C)=NC(C)=C(C(=O)C=C=O)C1c1c(C)cc(C)cc1C |
| InChI | InChI=1S/C22H25NO4/c1-7-27-22(26)20-16(6)23-15(5)19(17(25)8-9-24)21(20)18-13(3)10-12(2)11-14(18)4/h8,10-11,20-21H,7H2,1-6H3 |
| InChIKey | LKZJCUIBEICHMW-UHFFFAOYSA-N |
| XLogP | 3.58 |
| TPSA | 72.80 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 5 |
| Rotatable Bonds | 5 |
| Heavy Atoms | 27 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 367.45 |
| LogP ≤ 5 | 3.58 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 5 |
| Structural Alerts | {'alert_name': 'ketene', 'substructure': 'N/A'}, {'alert_name': 'Michael_acceptor_1', 'substructure': 'N/A'} |
|---|