C6H8N4O2 — CID 90713372
(1R)-3-azido-1-(1,3-oxazol-2-yl)propan-1-ol (PubChem CID 90713372) has the molecular formula C6H8N4O2 and a molecular weight of 168.16 g/mol. Its IUPAC name is (1R)-3-azido-1-(1,3-oxazol-2-yl)propan-1-ol.
| Compound Name | (1R)-3-azido-1-(1,3-oxazol-2-yl)propan-1-ol |
|---|---|
| PubChem CID | 90713372 |
| Molecular Formula | C6H8N4O2 |
| Molecular Weight | 168.16 g/mol |
| Exact Mass | 168.06 |
| IUPAC Name | (1R)-3-azido-1-(1,3-oxazol-2-yl)propan-1-ol |
| SMILES | [N-]=[N+]=NCC[C@@H](O)c1ncco1 |
| InChI | InChI=1S/C6H8N4O2/c7-10-9-2-1-5(11)6-8-3-4-12-6/h3-5,11H,1-2H2/t5-/m1/s1 |
| InChIKey | GBSWRIGNSGNIPQ-RXMQYKEDSA-N |
| XLogP | 1.41 |
| TPSA | 95.02 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 4 |
| Rotatable Bonds | 4 |
| Heavy Atoms | 12 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 168.16 |
| LogP ≤ 5 | 1.41 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 4 |
| Structural Alerts | {'alert_name': 'azo_A(324)', 'substructure': 'N/A'}, {'alert_name': 'Azido_group', 'substructure': 'N/A'}, {'alert_name': 'diazo_group', 'substructure': 'N/A'}, {'alert_name': 'quaternary_nitrogen_3', 'substructure': 'N/A'} |
|---|