C28H25FN2O5 — CID 90714215
4-(4-fluorophenyl)-4-[[4-[(5-methyl-2-phenyl-1,3-oxazol-4-yl)methoxy]phenyl]methoxyamino]but-3-enoic acid (PubChem CID 90714215) has the molecular formula C28H25FN2O5 and a molecular weight of 488.52 g/mol. Its IUPAC name is 4-(4-fluorophenyl)-4-[[4-[(5-methyl-2-phenyl-1,3-oxazol-4-yl)methoxy]phenyl]methoxyamino]but-3-enoic acid.
| Compound Name | 4-(4-fluorophenyl)-4-[[4-[(5-methyl-2-phenyl-1,3-oxazol-4-yl)methoxy]phenyl]methoxyamino]but-3-enoic acid |
|---|---|
| PubChem CID | 90714215 |
| Molecular Formula | C28H25FN2O5 |
| Molecular Weight | 488.52 g/mol |
| Exact Mass | 488.17 |
| IUPAC Name | 4-(4-fluorophenyl)-4-[[4-[(5-methyl-2-phenyl-1,3-oxazol-4-yl)methoxy]phenyl]methoxyamino]but-3-enoic acid |
| SMILES | Cc1oc(-c2ccccc2)nc1COc1ccc(CONC(=CCC(=O)O)c2ccc(F)cc2)cc1 |
| InChI | InChI=1S/C28H25FN2O5/c1-19-26(30-28(36-19)22-5-3-2-4-6-22)18-34-24-13-7-20(8-14-24)17-35-31-25(15-16-27(32)33)21-9-11-23(29)12-10-21/h2-15,31H,16-18H2,1H3,(H,32,33) |
| InChIKey | RGETYEMFFQAFIF-UHFFFAOYSA-N |
| XLogP | 5.91 |
| TPSA | 93.82 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 6 |
| Rotatable Bonds | 11 |
| Heavy Atoms | 36 |
| Complexity | — |
1 violation
| Rule | Value |
|---|---|
| MW ≤ 500 | 488.52 |
| LogP ≤ 5 | 5.91 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 6 |
| Structural Alerts | {'alert_name': 'Oxygen-nitrogen_single_bond', 'substructure': 'N/A'} |
|---|