C33H36N2O5 — CID 57111007
methyl 2,2-dimethyl-6-[[4-[(5-methyl-2-phenyl-1,3-oxazol-4-yl)methoxy]phenyl]methoxyamino]-6-phenylhex-5-enoate (PubChem CID 57111007) has the molecular formula C33H36N2O5 and a molecular weight of 540.66 g/mol. Its IUPAC name is methyl 2,2-dimethyl-6-[[4-[(5-methyl-2-phenyl-1,3-oxazol-4-yl)methoxy]phenyl]methoxyamino]-6-phenylhex-5-enoate.
| Compound Name | methyl 2,2-dimethyl-6-[[4-[(5-methyl-2-phenyl-1,3-oxazol-4-yl)methoxy]phenyl]methoxyamino]-6-phenylhex-5-enoate |
|---|---|
| PubChem CID | 57111007 |
| Molecular Formula | C33H36N2O5 |
| Molecular Weight | 540.66 g/mol |
| Exact Mass | 540.26 |
| IUPAC Name | methyl 2,2-dimethyl-6-[[4-[(5-methyl-2-phenyl-1,3-oxazol-4-yl)methoxy]phenyl]methoxyamino]-6-phenylhex-5-enoate |
| SMILES | COC(=O)C(C)(C)CCC=C(NOCc1ccc(OCc2nc(-c3ccccc3)oc2C)cc1)c1ccccc1 |
| InChI | InChI=1S/C33H36N2O5/c1-24-30(34-31(40-24)27-14-9-6-10-15-27)23-38-28-19-17-25(18-20-28)22-39-35-29(26-12-7-5-8-13-26)16-11-21-33(2,3)32(36)37-4/h5-10,12-20,35H,11,21-23H2,1-4H3 |
| InChIKey | YDBUIFLTDSOPHE-UHFFFAOYSA-N |
| XLogP | 7.27 |
| TPSA | 82.82 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 7 |
| Rotatable Bonds | 13 |
| Heavy Atoms | 40 |
| Complexity | — |
2 violations
| Rule | Value |
|---|---|
| MW ≤ 500 | 540.66 |
| LogP ≤ 5 | 7.27 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 7 |
| Structural Alerts | {'alert_name': 'Oxygen-nitrogen_single_bond', 'substructure': 'N/A'} |
|---|