C31H33N3O6S — CID 57008727
6-[[4-[(5-methyl-2-phenyl-1,3-oxazol-4-yl)methoxy]phenyl]methoxyamino]-N-methylsulfonyl-6-phenylhex-5-enamide (PubChem CID 57008727) has the molecular formula C31H33N3O6S and a molecular weight of 575.69 g/mol. Its IUPAC name is 6-[[4-[(5-methyl-2-phenyl-1,3-oxazol-4-yl)methoxy]phenyl]methoxyamino]-N-methylsulfonyl-6-phenylhex-5-enamide.
| Compound Name | 6-[[4-[(5-methyl-2-phenyl-1,3-oxazol-4-yl)methoxy]phenyl]methoxyamino]-N-methylsulfonyl-6-phenylhex-5-enamide |
|---|---|
| PubChem CID | 57008727 |
| Molecular Formula | C31H33N3O6S |
| Molecular Weight | 575.69 g/mol |
| Exact Mass | 575.21 |
| IUPAC Name | 6-[[4-[(5-methyl-2-phenyl-1,3-oxazol-4-yl)methoxy]phenyl]methoxyamino]-N-methylsulfonyl-6-phenylhex-5-enamide |
| SMILES | Cc1oc(-c2ccccc2)nc1COc1ccc(CONC(=CCCCC(=O)NS(C)(=O)=O)c2ccccc2)cc1 |
| InChI | InChI=1S/C31H33N3O6S/c1-23-29(32-31(40-23)26-13-7-4-8-14-26)22-38-27-19-17-24(18-20-27)21-39-33-28(25-11-5-3-6-12-25)15-9-10-16-30(35)34-41(2,36)37/h3-8,11-15,17-20,33H,9-10,16,21-22H2,1-2H3,(H,34,35) |
| InChIKey | VYGDZULGJMNAEK-UHFFFAOYSA-N |
| XLogP | 5.54 |
| TPSA | 119.76 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 8 |
| Rotatable Bonds | 14 |
| Heavy Atoms | 41 |
| Complexity | — |
2 violations
| Rule | Value |
|---|---|
| MW ≤ 500 | 575.69 |
| LogP ≤ 5 | 5.54 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 8 |
| Structural Alerts | {'alert_name': 'Aliphatic_long_chain', 'substructure': 'N/A'}, {'alert_name': 'Oxygen-nitrogen_single_bond', 'substructure': 'N/A'} |
|---|