C19H27NO5 — CID 90714296
methyl 2-methyl-5-[4-(1-phenylethenylamino)oxybutyl]-1,3-dioxane-2-carboxylate (PubChem CID 90714296) has the molecular formula C19H27NO5 and a molecular weight of 349.43 g/mol. Its IUPAC name is methyl 2-methyl-5-[4-(1-phenylethenylamino)oxybutyl]-1,3-dioxane-2-carboxylate.
| Compound Name | methyl 2-methyl-5-[4-(1-phenylethenylamino)oxybutyl]-1,3-dioxane-2-carboxylate |
|---|---|
| PubChem CID | 90714296 |
| Molecular Formula | C19H27NO5 |
| Molecular Weight | 349.43 g/mol |
| Exact Mass | 349.19 |
| IUPAC Name | methyl 2-methyl-5-[4-(1-phenylethenylamino)oxybutyl]-1,3-dioxane-2-carboxylate |
| SMILES | C=C(NOCCCCC1COC(C)(C(=O)OC)OC1)c1ccccc1 |
| InChI | InChI=1S/C19H27NO5/c1-15(17-10-5-4-6-11-17)20-25-12-8-7-9-16-13-23-19(2,24-14-16)18(21)22-3/h4-6,10-11,16,20H,1,7-9,12-14H2,2-3H3 |
| InChIKey | CFBBALDLAFKESA-UHFFFAOYSA-N |
| XLogP | 2.90 |
| TPSA | 66.02 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 6 |
| Rotatable Bonds | 9 |
| Heavy Atoms | 25 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 349.43 |
| LogP ≤ 5 | 2.90 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 6 |
| Structural Alerts | {'alert_name': 'Aliphatic_long_chain', 'substructure': 'N/A'}, {'alert_name': 'Oxygen-nitrogen_single_bond', 'substructure': 'N/A'} |
|---|