C21H31NO5 — CID 90798568
2-methyl-5-[4-(1-phenylpent-1-enylamino)oxybutyl]-1,3-dioxane-2-carboxylic acid (PubChem CID 90798568) has the molecular formula C21H31NO5 and a molecular weight of 377.48 g/mol. Its IUPAC name is 2-methyl-5-[4-(1-phenylpent-1-enylamino)oxybutyl]-1,3-dioxane-2-carboxylic acid.
| Compound Name | 2-methyl-5-[4-(1-phenylpent-1-enylamino)oxybutyl]-1,3-dioxane-2-carboxylic acid |
|---|---|
| PubChem CID | 90798568 |
| Molecular Formula | C21H31NO5 |
| Molecular Weight | 377.48 g/mol |
| Exact Mass | 377.22 |
| IUPAC Name | 2-methyl-5-[4-(1-phenylpent-1-enylamino)oxybutyl]-1,3-dioxane-2-carboxylic acid |
| SMILES | CCCC=C(NOCCCCC1COC(C)(C(=O)O)OC1)c1ccccc1 |
| InChI | InChI=1S/C21H31NO5/c1-3-4-13-19(18-11-6-5-7-12-18)22-27-14-9-8-10-17-15-25-21(2,20(23)24)26-16-17/h5-7,11-13,17,22H,3-4,8-10,14-16H2,1-2H3,(H,23,24) |
| InChIKey | PEWBNSWGBOXBOW-UHFFFAOYSA-N |
| XLogP | 3.98 |
| TPSA | 77.02 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 5 |
| Rotatable Bonds | 11 |
| Heavy Atoms | 27 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 377.48 |
| LogP ≤ 5 | 3.98 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 5 |
| Structural Alerts | {'alert_name': 'Aliphatic_long_chain', 'substructure': 'N/A'}, {'alert_name': 'Oxygen-nitrogen_single_bond', 'substructure': 'N/A'} |
|---|