C19H26ClNO5 — CID 90960364
methyl 5-[4-[1-(4-chlorophenyl)ethenylamino]oxybutyl]-2-methyl-1,3-dioxane-2-carboxylate (PubChem CID 90960364) has the molecular formula C19H26ClNO5 and a molecular weight of 383.87 g/mol. Its IUPAC name is methyl 5-[4-[1-(4-chlorophenyl)ethenylamino]oxybutyl]-2-methyl-1,3-dioxane-2-carboxylate.
| Compound Name | methyl 5-[4-[1-(4-chlorophenyl)ethenylamino]oxybutyl]-2-methyl-1,3-dioxane-2-carboxylate |
|---|---|
| PubChem CID | 90960364 |
| Molecular Formula | C19H26ClNO5 |
| Molecular Weight | 383.87 g/mol |
| Exact Mass | 383.15 |
| IUPAC Name | methyl 5-[4-[1-(4-chlorophenyl)ethenylamino]oxybutyl]-2-methyl-1,3-dioxane-2-carboxylate |
| SMILES | C=C(NOCCCCC1COC(C)(C(=O)OC)OC1)c1ccc(Cl)cc1 |
| InChI | InChI=1S/C19H26ClNO5/c1-14(16-7-9-17(20)10-8-16)21-26-11-5-4-6-15-12-24-19(2,25-13-15)18(22)23-3/h7-10,15,21H,1,4-6,11-13H2,2-3H3 |
| InChIKey | RCWCPXNKZBBQCB-UHFFFAOYSA-N |
| XLogP | 3.55 |
| TPSA | 66.02 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 6 |
| Rotatable Bonds | 9 |
| Heavy Atoms | 26 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 383.87 |
| LogP ≤ 5 | 3.55 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 6 |
| Structural Alerts | {'alert_name': 'Aliphatic_long_chain', 'substructure': 'N/A'}, {'alert_name': 'Oxygen-nitrogen_single_bond', 'substructure': 'N/A'} |
|---|