C19H27NO5 — CID 91152895
2-methyl-5-[4-[1-(4-methylphenyl)ethenylamino]oxybutyl]-1,3-dioxane-2-carboxylic acid (PubChem CID 91152895) has the molecular formula C19H27NO5 and a molecular weight of 349.43 g/mol. Its IUPAC name is 2-methyl-5-[4-[1-(4-methylphenyl)ethenylamino]oxybutyl]-1,3-dioxane-2-carboxylic acid.
| Compound Name | 2-methyl-5-[4-[1-(4-methylphenyl)ethenylamino]oxybutyl]-1,3-dioxane-2-carboxylic acid |
|---|---|
| PubChem CID | 91152895 |
| Molecular Formula | C19H27NO5 |
| Molecular Weight | 349.43 g/mol |
| Exact Mass | 349.19 |
| IUPAC Name | 2-methyl-5-[4-[1-(4-methylphenyl)ethenylamino]oxybutyl]-1,3-dioxane-2-carboxylic acid |
| SMILES | C=C(NOCCCCC1COC(C)(C(=O)O)OC1)c1ccc(C)cc1 |
| InChI | InChI=1S/C19H27NO5/c1-14-7-9-17(10-8-14)15(2)20-25-11-5-4-6-16-12-23-19(3,18(21)22)24-13-16/h7-10,16,20H,2,4-6,11-13H2,1,3H3,(H,21,22) |
| InChIKey | MDQUCHBHKOBVQT-UHFFFAOYSA-N |
| XLogP | 3.12 |
| TPSA | 77.02 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 5 |
| Rotatable Bonds | 9 |
| Heavy Atoms | 25 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 349.43 |
| LogP ≤ 5 | 3.12 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 5 |
| Structural Alerts | {'alert_name': 'Aliphatic_long_chain', 'substructure': 'N/A'}, {'alert_name': 'Oxygen-nitrogen_single_bond', 'substructure': 'N/A'} |
|---|