C23H29NO5 — CID 90976745
2-methyl-5-[5-(1-naphthalen-2-ylethenylamino)oxypentyl]-1,3-dioxane-2-carboxylic acid (PubChem CID 90976745) has the molecular formula C23H29NO5 and a molecular weight of 399.49 g/mol. Its IUPAC name is 2-methyl-5-[5-(1-naphthalen-2-ylethenylamino)oxypentyl]-1,3-dioxane-2-carboxylic acid.
| Compound Name | 2-methyl-5-[5-(1-naphthalen-2-ylethenylamino)oxypentyl]-1,3-dioxane-2-carboxylic acid |
|---|---|
| PubChem CID | 90976745 |
| Molecular Formula | C23H29NO5 |
| Molecular Weight | 399.49 g/mol |
| Exact Mass | 399.20 |
| IUPAC Name | 2-methyl-5-[5-(1-naphthalen-2-ylethenylamino)oxypentyl]-1,3-dioxane-2-carboxylic acid |
| SMILES | C=C(NOCCCCCC1COC(C)(C(=O)O)OC1)c1ccc2ccccc2c1 |
| InChI | InChI=1S/C23H29NO5/c1-17(20-12-11-19-9-5-6-10-21(19)14-20)24-29-13-7-3-4-8-18-15-27-23(2,22(25)26)28-16-18/h5-6,9-12,14,18,24H,1,3-4,7-8,13,15-16H2,2H3,(H,25,26) |
| InChIKey | JDDRRUBQGAJJLI-UHFFFAOYSA-N |
| XLogP | 4.36 |
| TPSA | 77.02 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 5 |
| Rotatable Bonds | 10 |
| Heavy Atoms | 29 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 399.49 |
| LogP ≤ 5 | 4.36 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 5 |
| Structural Alerts | {'alert_name': 'Aliphatic_long_chain', 'substructure': 'N/A'}, {'alert_name': 'Oxygen-nitrogen_single_bond', 'substructure': 'N/A'} |
|---|