C20H29NO5 — CID 91273940
2-methyl-5-[4-[1-(4-methylphenyl)prop-1-enylamino]oxybutyl]-1,3-dioxane-2-carboxylic acid (PubChem CID 91273940) has the molecular formula C20H29NO5 and a molecular weight of 363.45 g/mol. Its IUPAC name is 2-methyl-5-[4-[1-(4-methylphenyl)prop-1-enylamino]oxybutyl]-1,3-dioxane-2-carboxylic acid.
| Compound Name | 2-methyl-5-[4-[1-(4-methylphenyl)prop-1-enylamino]oxybutyl]-1,3-dioxane-2-carboxylic acid |
|---|---|
| PubChem CID | 91273940 |
| Molecular Formula | C20H29NO5 |
| Molecular Weight | 363.45 g/mol |
| Exact Mass | 363.20 |
| IUPAC Name | 2-methyl-5-[4-[1-(4-methylphenyl)prop-1-enylamino]oxybutyl]-1,3-dioxane-2-carboxylic acid |
| SMILES | CC=C(NOCCCCC1COC(C)(C(=O)O)OC1)c1ccc(C)cc1 |
| InChI | InChI=1S/C20H29NO5/c1-4-18(17-10-8-15(2)9-11-17)21-26-12-6-5-7-16-13-24-20(3,19(22)23)25-14-16/h4,8-11,16,21H,5-7,12-14H2,1-3H3,(H,22,23) |
| InChIKey | IPSXZIRVBWTFCA-UHFFFAOYSA-N |
| XLogP | 3.51 |
| TPSA | 77.02 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 5 |
| Rotatable Bonds | 9 |
| Heavy Atoms | 26 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 363.45 |
| LogP ≤ 5 | 3.51 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 5 |
| Structural Alerts | {'alert_name': 'Aliphatic_long_chain', 'substructure': 'N/A'}, {'alert_name': 'Oxygen-nitrogen_single_bond', 'substructure': 'N/A'} |
|---|