C23H33NO5 — CID 91300798
methyl 2-methyl-5-[4-[1-(5,6,7,8-tetrahydronaphthalen-2-yl)ethenylamino]oxybutyl]-1,3-dioxane-2-carboxylate (PubChem CID 91300798) has the molecular formula C23H33NO5 and a molecular weight of 403.52 g/mol. Its IUPAC name is methyl 2-methyl-5-[4-[1-(5,6,7,8-tetrahydronaphthalen-2-yl)ethenylamino]oxybutyl]-1,3-dioxane-2-carboxylate.
| Compound Name | methyl 2-methyl-5-[4-[1-(5,6,7,8-tetrahydronaphthalen-2-yl)ethenylamino]oxybutyl]-1,3-dioxane-2-carboxylate |
|---|---|
| PubChem CID | 91300798 |
| Molecular Formula | C23H33NO5 |
| Molecular Weight | 403.52 g/mol |
| Exact Mass | 403.24 |
| IUPAC Name | methyl 2-methyl-5-[4-[1-(5,6,7,8-tetrahydronaphthalen-2-yl)ethenylamino]oxybutyl]-1,3-dioxane-2-carboxylate |
| SMILES | C=C(NOCCCCC1COC(C)(C(=O)OC)OC1)c1ccc2c(c1)CCCC2 |
| InChI | InChI=1S/C23H33NO5/c1-17(20-12-11-19-9-4-5-10-21(19)14-20)24-29-13-7-6-8-18-15-27-23(2,28-16-18)22(25)26-3/h11-12,14,18,24H,1,4-10,13,15-16H2,2-3H3 |
| InChIKey | HDJVDZVQFKUROG-UHFFFAOYSA-N |
| XLogP | 3.78 |
| TPSA | 66.02 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 6 |
| Rotatable Bonds | 9 |
| Heavy Atoms | 29 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 403.52 |
| LogP ≤ 5 | 3.78 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 6 |
| Structural Alerts | {'alert_name': 'Aliphatic_long_chain', 'substructure': 'N/A'}, {'alert_name': 'Oxygen-nitrogen_single_bond', 'substructure': 'N/A'} |
|---|