C22H33NO5 — CID 90998403
methyl 2-methyl-5-[4-(1-phenylpent-1-enylamino)oxybutyl]-1,3-dioxane-2-carboxylate (PubChem CID 90998403) has the molecular formula C22H33NO5 and a molecular weight of 391.51 g/mol. Its IUPAC name is methyl 2-methyl-5-[4-(1-phenylpent-1-enylamino)oxybutyl]-1,3-dioxane-2-carboxylate.
| Compound Name | methyl 2-methyl-5-[4-(1-phenylpent-1-enylamino)oxybutyl]-1,3-dioxane-2-carboxylate |
|---|---|
| PubChem CID | 90998403 |
| Molecular Formula | C22H33NO5 |
| Molecular Weight | 391.51 g/mol |
| Exact Mass | 391.24 |
| IUPAC Name | methyl 2-methyl-5-[4-(1-phenylpent-1-enylamino)oxybutyl]-1,3-dioxane-2-carboxylate |
| SMILES | CCCC=C(NOCCCCC1COC(C)(C(=O)OC)OC1)c1ccccc1 |
| InChI | InChI=1S/C22H33NO5/c1-4-5-14-20(19-12-7-6-8-13-19)23-28-15-10-9-11-18-16-26-22(2,27-17-18)21(24)25-3/h6-8,12-14,18,23H,4-5,9-11,15-17H2,1-3H3 |
| InChIKey | HMRICGALKZUBEB-UHFFFAOYSA-N |
| XLogP | 4.07 |
| TPSA | 66.02 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 6 |
| Rotatable Bonds | 11 |
| Heavy Atoms | 28 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 391.51 |
| LogP ≤ 5 | 4.07 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 6 |
| Structural Alerts | {'alert_name': 'Aliphatic_long_chain', 'substructure': 'N/A'}, {'alert_name': 'Oxygen-nitrogen_single_bond', 'substructure': 'N/A'} |
|---|