C20H29NO5 — CID 91272582
methyl 2-methyl-5-[4-[1-(3-methylphenyl)ethenylamino]oxybutyl]-1,3-dioxane-2-carboxylate (PubChem CID 91272582) has the molecular formula C20H29NO5 and a molecular weight of 363.45 g/mol. Its IUPAC name is methyl 2-methyl-5-[4-[1-(3-methylphenyl)ethenylamino]oxybutyl]-1,3-dioxane-2-carboxylate.
| Compound Name | methyl 2-methyl-5-[4-[1-(3-methylphenyl)ethenylamino]oxybutyl]-1,3-dioxane-2-carboxylate |
|---|---|
| PubChem CID | 91272582 |
| Molecular Formula | C20H29NO5 |
| Molecular Weight | 363.45 g/mol |
| Exact Mass | 363.20 |
| IUPAC Name | methyl 2-methyl-5-[4-[1-(3-methylphenyl)ethenylamino]oxybutyl]-1,3-dioxane-2-carboxylate |
| SMILES | C=C(NOCCCCC1COC(C)(C(=O)OC)OC1)c1cccc(C)c1 |
| InChI | InChI=1S/C20H29NO5/c1-15-8-7-10-18(12-15)16(2)21-26-11-6-5-9-17-13-24-20(3,25-14-17)19(22)23-4/h7-8,10,12,17,21H,2,5-6,9,11,13-14H2,1,3-4H3 |
| InChIKey | ZXZQTPSRJCHAJB-UHFFFAOYSA-N |
| XLogP | 3.21 |
| TPSA | 66.02 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 6 |
| Rotatable Bonds | 9 |
| Heavy Atoms | 26 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 363.45 |
| LogP ≤ 5 | 3.21 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 6 |
| Structural Alerts | {'alert_name': 'Aliphatic_long_chain', 'substructure': 'N/A'}, {'alert_name': 'Oxygen-nitrogen_single_bond', 'substructure': 'N/A'} |
|---|