C63H88N2O2S2 — CID 90715975
1-[5-(7-tert-butyl-9,9-dihexylfluoren-2-yl)thiophen-2-yl]-4-(5-tert-butylthiophen-2-yl)-2,5-bis(2-ethylhexyl)pyrrolo[3,4-c]pyrrole-3,6-dione (PubChem CID 90715975) has the molecular formula C63H88N2O2S2 and a molecular weight of 969.54 g/mol. Its IUPAC name is 1-[5-(7-tert-butyl-9,9-dihexylfluoren-2-yl)thiophen-2-yl]-4-(5-tert-butylthiophen-2-yl)-2,5-bis(2-ethylhexyl)pyrrolo[3,4-c]pyrrole-3,6-dione.
| Compound Name | 1-[5-(7-tert-butyl-9,9-dihexylfluoren-2-yl)thiophen-2-yl]-4-(5-tert-butylthiophen-2-yl)-2,5-bis(2-ethylhexyl)pyrrolo[3,4-c]pyrrole-3,6-dione |
|---|---|
| PubChem CID | 90715975 |
| Molecular Formula | C63H88N2O2S2 |
| Molecular Weight | 969.54 g/mol |
| Exact Mass | 968.63 |
| IUPAC Name | 1-[5-(7-tert-butyl-9,9-dihexylfluoren-2-yl)thiophen-2-yl]-4-(5-tert-butylthiophen-2-yl)-2,5-bis(2-ethylhexyl)pyrrolo[3,4-c]pyrrole-3,6-dione |
| SMILES | CCCCCCC1(CCCCCC)c2cc(-c3ccc(C4=C5C(=O)N(CC(CC)CCCC)C(c6ccc(C(C)(C)C)s6)=C5C(=O)N4CC(CC)CCCC)s3)ccc2-c2ccc(C(C)(C)C)cc21 |
| InChI | InChI=1S/C63H88N2O2S2/c1-13-19-23-25-37-63(38-26-24-20-14-2)49-39-45(29-31-47(49)48-32-30-46(40-50(48)63)61(7,8)9)51-33-34-52(68-51)57-55-56(60(67)64(57)41-43(17-5)27-21-15-3)58(53-35-36-54(69-53)62(10,11)12)65(59(55)66)42-44(18-6)28-22-16-4/h29-36,39-40,43-44H,13-28,37-38,41-42H2,1-12H3 |
| InChIKey | UXDHQKGJVYSZIF-UHFFFAOYSA-N |
| XLogP | 18.52 |
| TPSA | 40.62 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 4 |
| Rotatable Bonds | 25 |
| Heavy Atoms | 69 |
| Complexity | — |
2 violations
| Rule | Value |
|---|---|
| MW ≤ 500 | 969.54 |
| LogP ≤ 5 | 18.52 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 4 |
| Structural Alerts | {'alert_name': 'ene_five_het_C(85)', 'substructure': 'N/A'}, {'alert_name': 'Aliphatic_long_chain', 'substructure': 'N/A'} |
|---|