C72H107N3O2S2 — CID 91414216
1-[5-(7-tert-butyl-9-hexylcarbazol-2-yl)thiophen-2-yl]-4-(5-tert-butylthiophen-2-yl)-2,5-bis(2-hexyldecyl)pyrrolo[3,4-c]pyrrole-3,6-dione (PubChem CID 91414216) has the molecular formula C72H107N3O2S2 and a molecular weight of 1110.80 g/mol. Its IUPAC name is 1-[5-(7-tert-butyl-9-hexylcarbazol-2-yl)thiophen-2-yl]-4-(5-tert-butylthiophen-2-yl)-2,5-bis(2-hexyldecyl)pyrrolo[3,4-c]pyrrole-3,6-dione.
| Compound Name | 1-[5-(7-tert-butyl-9-hexylcarbazol-2-yl)thiophen-2-yl]-4-(5-tert-butylthiophen-2-yl)-2,5-bis(2-hexyldecyl)pyrrolo[3,4-c]pyrrole-3,6-dione |
|---|---|
| PubChem CID | 91414216 |
| Molecular Formula | C72H107N3O2S2 |
| Molecular Weight | 1110.80 g/mol |
| Exact Mass | 1109.78 |
| IUPAC Name | 1-[5-(7-tert-butyl-9-hexylcarbazol-2-yl)thiophen-2-yl]-4-(5-tert-butylthiophen-2-yl)-2,5-bis(2-hexyldecyl)pyrrolo[3,4-c]pyrrole-3,6-dione |
| SMILES | CCCCCCCCC(CCCCCC)CN1C(=O)C2=C(c3ccc(C(C)(C)C)s3)N(CC(CCCCCC)CCCCCCCC)C(=O)C2=C1c1ccc(-c2ccc3c4ccc(C(C)(C)C)cc4n(CCCCCC)c3c2)s1 |
| InChI | InChI=1S/C72H107N3O2S2/c1-12-17-22-27-29-33-38-53(36-31-24-19-14-3)51-74-67(62-45-44-61(78-62)55-40-42-57-58-43-41-56(71(6,7)8)50-60(58)73(59(57)49-55)48-35-26-21-16-5)65-66(70(74)77)68(63-46-47-64(79-63)72(9,10)11)75(69(65)76)52-54(37-32-25-20-15-4)39-34-30-28-23-18-13-2/h40-47,49-50,53-54H,12-39,48,51-52H2,1-11H3 |
| InChIKey | WQPKXYPBRUSWTF-UHFFFAOYSA-N |
| XLogP | 22.24 |
| TPSA | 45.55 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 5 |
| Rotatable Bonds | 36 |
| Heavy Atoms | 79 |
| Complexity | — |
2 violations
| Rule | Value |
|---|---|
| MW ≤ 500 | 1110.80 |
| LogP ≤ 5 | 22.24 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 5 |
| Structural Alerts | {'alert_name': 'ene_five_het_C(85)', 'substructure': 'N/A'}, {'alert_name': 'Aliphatic_long_chain', 'substructure': 'N/A'} |
|---|