C46H72N2O2S2Sn2 — CID 166519230
tert-butyl-[5-[4-[5-(tert-butyl-λ2-stannanyl)thiophen-2-yl]-2,5-bis(2-butyloctyl)-3,6-dioxopyrrolo[3,4-c]pyrrol-1-yl]thiophen-2-yl]tin (PubChem CID 166519230) has the molecular formula C46H72N2O2S2Sn2 and a molecular weight of 986.65 g/mol. Its IUPAC name is tert-butyl-[5-[4-[5-(tert-butyl-λ2-stannanyl)thiophen-2-yl]-2,5-bis(2-butyloctyl)-3,6-dioxopyrrolo[3,4-c]pyrrol-1-yl]thiophen-2-yl]tin.
| Compound Name | tert-butyl-[5-[4-[5-(tert-butyl-λ2-stannanyl)thiophen-2-yl]-2,5-bis(2-butyloctyl)-3,6-dioxopyrrolo[3,4-c]pyrrol-1-yl]thiophen-2-yl]tin |
|---|---|
| PubChem CID | 166519230 |
| Molecular Formula | C46H72N2O2S2Sn2 |
| Molecular Weight | 986.65 g/mol |
| Exact Mass | 988.31 |
| IUPAC Name | tert-butyl-[5-[4-[5-(tert-butyl-λ2-stannanyl)thiophen-2-yl]-2,5-bis(2-butyloctyl)-3,6-dioxopyrrolo[3,4-c]pyrrol-1-yl]thiophen-2-yl]tin |
| SMILES | CCCCCCC(CCCC)CN1C(=O)C2=C(c3ccc([Sn]C(C)(C)C)s3)N(CC(CCCC)CCCCCC)C(=O)C2=C1c1ccc([Sn]C(C)(C)C)s1 |
| InChI | InChI=1S/C38H54N2O2S2.2C4H9.2Sn/c1-5-9-13-15-21-29(19-11-7-3)27-39-35(31-23-17-25-43-31)33-34(37(39)41)36(32-24-18-26-44-32)40(38(33)42)28-30(20-12-8-4)22-16-14-10-6-2;2*1-4(2)3;;/h17-18,23-24,29-30H,5-16,19-22,27-28H2,1-4H3;2*1-3H3;; |
| InChIKey | WXUUESOYXQJSAD-UHFFFAOYSA-N |
| XLogP | 12.27 |
| TPSA | 40.62 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 4 |
| Rotatable Bonds | 24 |
| Heavy Atoms | 54 |
| Complexity | — |
2 violations
| Rule | Value |
|---|---|
| MW ≤ 500 | 986.65 |
| LogP ≤ 5 | 12.27 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 4 |
| Structural Alerts | {'alert_name': 'ene_five_het_C(85)', 'substructure': 'N/A'}, {'alert_name': 'Aliphatic_long_chain', 'substructure': 'N/A'} |
|---|